N,N-dipropylaniline


di-N-propylaniline; N,N-dipropylaniline
Links:📏 NIST
CAS:[2217-07-4]
Formula:C12H19N; 177.29 g/mol
InChiKey:MMFBQHXDINNBMW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)N(CCC)CCC
Molecular structure of N,N-dipropylaniline
Density:0.918 g/mL
Molar volume:193.2 mL/mol
Refractive index:1.529
Molecular refractive power:59.56 mL/mol
Boiling point:242 °C
Surface tension:32.79 dyn/cm
Immiscible with:
(+-)-3-chloro-1,2-propanediol,    (R,S)-2,3-butanediol,    1,2,3-propanetriol,    1,2-propanediol,    1,3-butanediol,    1,3-propanediol,    2-(2-aminoethylamino)ethanol,    4-hydroxy-4-methylpentan-2-one,    ethanediol,    formamide,    triethanolamine,    triethylene glycol
Miscible with:
(E)-3-phenyl-2-propenal,    1,2-diacetoxyethane,    1,2-diethoxyethane,    1-heptadecanol,    1-tetradecanol,    2,4-pentanedione,    2,6,8-trimethyl-4-nonanone,    2,6-dimethyl-4-heptanone,    2-(2-butoxyethoxy)ethanol,    2-(2-ethoxyethoxy)ethanol,    2-(2-methoxyethoxy)ethanol,    2-bromoethyl acetate,    2-butoxyethanol,    2-chloroethanol,    2-ethoxyaniline,    2-ethoxyethanol,    2-ethylbutanoic acid,    2-ethylhexanol,    2-methoxyethanol,    2-phenoxyethanol,    2-propanone,    3,6,9-trioxaundecane,    3-chloropropanol,    3-heptanol,    3-methyl-1-butanol,    3-methyl-2-butanone,    3-methylbutyl acetate,    4-methyl-2-pentanone,    4-methylpentanoic acid,    4-oxa-2,6-heptandiol,    N,N-diethylformamide,    N,N-dimethylaniline,    N-(2-aminoethyl)ethane-1,2-diamine,    a-methylbenzyldimethylamine,    aniline,    benzene,    benzyl alcohol,    butanol,    butyl acetate,    dibenzyl ether,    dibutyl carbonate,    dibutyl hydrogen phosphite,    diethyl ether,    diethylene glycol dibutyl ether,    dihexyl ether,    diisopropylamine,    dipentylamine,    ethanol,    ethyl (E)-3-phenylprop-2-enoate,    ethyl benzoate,    ethyl chloroacetate,    ethyl phenylacetate,    furfuryl alcohol,    heptyl acetate,    pyridine,    tetrachloromethane,    tetraethylene glycol dibutyl ether,    tributyl phosphate,    trichloromethane,    triethyl phosphate,    triethylenetetramine

Isomers

N-tert-butyl-3,5-dimethylaniline
Molecular structure of N-tert-butyl-3,5-dimethylaniline
4-tert-butyl-N,N-dimethylaniline
Molecular structure of 4-tert-butyl-N,N-dimethylaniline
N,N-diisopropylaniline
Molecular structure of N,N-diisopropylaniline
2,6-diisopropylaniline
Molecular structure of 2,6-diisopropylaniline
N,N-dipropylaniline
Molecular structure of N,N-dipropylaniline
2-heptylpyridine
Molecular structure of 2-heptylpyridine
3-heptylpyridine
Molecular structure of 3-heptylpyridine
4-heptylpyridine
Molecular structure of 4-heptylpyridine
N-hexylaniline
Molecular structure of N-hexylaniline
4-hexylaniline
Molecular structure of 4-hexylaniline
isopropylamphetamine
Molecular structure of isopropylamphetamine
1-phenyl-2-amino-3,3-dimethylbutane
Molecular structure of 1-phenyl-2-amino-3,3-dimethylbutane
1-phenyl-2-aminohexane
Molecular structure of 1-phenyl-2-aminohexane
1-phenyl-2-amino-4-methylpentane
Molecular structure of 1-phenyl-2-amino-4-methylpentane
1-phenyl-N-propylpropan-2-amine
Molecular structure of 1-phenyl-N-propylpropan-2-amine
4-(1-propylbutyl)pyridine
Molecular structure of 4-(1-propylbutyl)pyridine
1-(3,4,5-trimethylphenyl)-2-aminopropane
Molecular structure of 1-(3,4,5-trimethylphenyl)-2-aminopropane