4-bromoacetanilide


p-bromoacetanilide; 4-bromoacetanilide; 4'-bromoacetanilide; N-(4-bromophenyl)acetamide
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[103-88-8]
Formula:C8H8BrNO; 214.06 g/mol
InChiKey:MSLICLMCQYQNPK-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(Br)cc1
Molecular structure of 4-bromoacetanilide
Melting point:167 °C
Log10 partition octanol / water:2.29
1g dissolves in:
15.65g ethanol

Isomers

3'-amino-4'-bromoacetophenone
Molecular structure of 3'-amino-4'-bromoacetophenone
2-bromoacetanilide
Molecular structure of 2-bromoacetanilide
3-bromoacetanilide
Molecular structure of 3-bromoacetanilide
4-bromoacetanilide
Molecular structure of 4-bromoacetanilide
4'-bromoacetophenone oxime
Molecular structure of 4'-bromoacetophenone oxime
4-bromo-3-methylbenzamide
Molecular structure of 4-bromo-3-methylbenzamide
N-(2-bromophenyl)acetamide
Molecular structure of N-(2-bromophenyl)acetamide