2-(phenoxycarbonyl)phenol


2-hydroxybenzoic acid phenyl ester; 2-(phenoxycarbonyl)phenol; phenyl 2-hydroxybenzoate; phenyl salicylate; salol
Links:📏 NIST, ⚗️ ChemSynthesis
CAS RN:[118-55-8]
Formula:C13H10O3; 214.22 g/mol
InChiKey:ZQBAKBUEJOMQEX-UHFFFAOYSA-N
SMILES:Oc1ccccc1C(=O)Oc2ccccc2
Molecular structure of phenyl 2-hydroxybenzoate
Density:1.250 g/mL
Molar volume:171.4 mL/mol
Dielectric constant:6.30
Dipole moment:3.15 D
Melting point:43 °C
Boiling point:313 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Dimroth ET:41.9
1g dissolves in:
0.10g 2-propanone;    0.13g benzene;    0.15g 1,3-dimethylbenzene;    0.17g pentyl acetate;    0.20g toluene;    0.58g acetic acid;    1.54g ethanol;    3.89g pentanol;    6,666.67g water

Isomers

(E,E)-1,5-di-2-furyl-2,4-pentadien-1-one
Molecular structure of (E,E)-1,5-di-2-furyl-2,4-pentadien-1-one
(E,E)-1,5-di-2-furyl-3-pentadienone
Molecular structure of (E,E)-1,5-di-2-furyl-3-pentadienone
2,2'-dihydroxybenzophenone
Molecular structure of 2,2'-dihydroxybenzophenone
2,4-dihydroxybenzophenone
Molecular structure of 2,4-dihydroxybenzophenone
4,4'-dihydroxybenzophenone
Molecular structure of 4,4'-dihydroxybenzophenone
(3,4-dihydroxyphenyl)-phenylmethanone
Molecular structure of (3,4-dihydroxyphenyl)-phenylmethanone
4,5-dimethylpsoralen
Molecular structure of 4,5-dimethylpsoralen
diphenyl carbonate
Molecular structure of diphenyl carbonate
(2E)-3-(2-furyl)-1-(4-hydroxyphenyl)prop-2-en-1-one
Molecular structure of (2E)-3-(2-furyl)-1-(4-hydroxyphenyl)prop-2-en-1-one
4'-hydroxybiphenyl-4-carboxylic acid
Molecular structure of 4'-hydroxybiphenyl-4-carboxylic acid
3-hydroxyphenyl benzoate
Molecular structure of 3-hydroxyphenyl benzoate
4-hydroxyphenyl benzoate
Molecular structure of 4-hydroxyphenyl benzoate
2-hydroxy-3-phenylbenzoic acid
Molecular structure of 2-hydroxy-3-phenylbenzoic acid
2-hydroxy-3-((E)-1-propenyl)naphtho-1,4-quinone
Molecular structure of 2-hydroxy-3-((E)-1-propenyl)naphtho-1,4-quinone
methyl 8-formyl-1-naphthoate
Molecular structure of methyl 8-formyl-1-naphthoate
2-phenoxybenzoic acid
Molecular structure of 2-phenoxybenzoic acid
3-phenoxybenzoic acid
Molecular structure of 3-phenoxybenzoic acid
4-phenoxybenzoic acid
Molecular structure of 4-phenoxybenzoic acid
phenyl 2-hydroxybenzoate
Molecular structure of phenyl 2-hydroxybenzoate
phenyl 4-hydroxybenzoate
Molecular structure of phenyl 4-hydroxybenzoate