1-(1-naphthyl)-1-ethanone oxime


methyl α-naphthyl ketoxime; 1-(1-naphthyl)-1-ethanone oxime
Formula:C12H11NO; 185.23 g/mol
InChiKey:KHNGQTJKEPANSZ-UHFFFAOYSA-N
SMILES:CC(=NO)c1cccc2ccccc12
Molecular structure of 1-(1-naphthyl)-1-ethanone oxime
Dipole moment:0.77 D

Isomers

N-acetyl-1-naphthylamine
Molecular structure of N-acetyl-1-naphthylamine
N-acetyl-2-naphthylamine
Molecular structure of N-acetyl-2-naphthylamine
3-aminobiphenyl-4-ol
Molecular structure of 3-aminobiphenyl-4-ol
2,2-dimethyl-2H-1-benzopyran-6-carbonitrile
Molecular structure of 2,2-dimethyl-2H-1-benzopyran-6-carbonitrile
1-naphthylacetamide
Molecular structure of 1-naphthylacetamide
1-(1-naphthyl)-1-ethanone oxime
Molecular structure of 1-(1-naphthyl)-1-ethanone oxime
1-(2-naphthyl)-1-ethanone oxime
Molecular structure of 1-(2-naphthyl)-1-ethanone oxime
2-phenoxyaniline
Molecular structure of 2-phenoxyaniline
3-phenoxyaniline
Molecular structure of 3-phenoxyaniline
4-phenoxyaniline
Molecular structure of 4-phenoxyaniline
3-(phenylamino)phenol
Molecular structure of 3-(phenylamino)phenol
4-(phenylamino)phenol
Molecular structure of 4-(phenylamino)phenol
pirfenidone
Molecular structure of pirfenidone
1,6,7,8-tetrahydrocyclopenta[γ]indole-3-carboxaldehyde
Molecular structure of 1,6,7,8-tetrahydrocyclopenta[g]indole-3-carboxaldehyde