1,1,2-tri(phenyl)guanidine


triphenylguanidine; α-triphenylguanidine; 1,1,2-tri(phenyl)guanidine
Links:📏 NIST, 🕷 ChemSpider
CAS:[603-53-2]
Formula:C19H17N3; 287.36 g/mol
InChiKey:RYCFRVNAZOREPC-UHFFFAOYSA-N
SMILES:NC(=Nc1ccccc1)N(c2ccccc2)c3ccccc3
Molecular structure of 1,1,2-tri(phenyl)guanidine
1g dissolves in:
16.05g ethanol

Isomers

1,1,2-tri(phenyl)guanidine
Molecular structure of 1,1,2-tri(phenyl)guanidine
1,2,3-triphenylguanidine
Molecular structure of 1,2,3-triphenylguanidine