1,8-dinitronaphthalene


1,8-dinitronaphthalene; β-dinitronaphthalene
Links:📏 NIST
CAS:[602-38-0]
Formula:C10H6N2O4; 218.17 g/mol
InChiKey:AVCSMMMOCOTIHF-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cccc2cccc(c12)[N+]([O-])=O
Molecular structure of 1,8-dinitronaphthalene
Dipole moment:7.10 D
Melting point:172 °C

Isomers

1,3-dinitronaphthalene
Molecular structure of 1,3-dinitronaphthalene
1,5-dinitronaphthalene
Molecular structure of 1,5-dinitronaphthalene
1,8-dinitronaphthalene
Molecular structure of 1,8-dinitronaphthalene
2,7-dinitronaphthalene
Molecular structure of 2,7-dinitronaphthalene
2,8-dinitrosonaphthalene-1,5-diol
Molecular structure of 2,8-dinitrosonaphthalene-1,5-diol
5-nitroquinoline-8-carboxylic acid
Molecular structure of 5-nitroquinoline-8-carboxylic acid