1,8-diazabiphenylene


1,8-diazabiphenylene
Formula:C10H6N2; 154.17 g/mol
InChiKey:DAEHFBVYBVCKNC-UHFFFAOYSA-N
SMILES:c1cnc2c(c1)c3cccnc23
Molecular structure of 1,8-diazabiphenylene
Dipole moment:4.23 D

Isomers

benzylidene malononitrile
Molecular structure of benzylidene malononitrile
4-cyanoquinoline
Molecular structure of 4-cyanoquinoline
1,8-diazabiphenylene
Molecular structure of 1,8-diazabiphenylene
isoquinoline-1-carbonitrile
Molecular structure of isoquinoline-1-carbonitrile
isoquinoline-3-carbonitrile
Molecular structure of isoquinoline-3-carbonitrile
2-(phenylmethylidene)propanedinitrile
Molecular structure of 2-(phenylmethylidene)propanedinitrile
quinoline-2-carbonitrile
Molecular structure of quinoline-2-carbonitrile
quinoline-3-carbonitrile
Molecular structure of quinoline-3-carbonitrile