1,7-phenanthroline


1,5-diazaphenanthrene; m-phenanthroline; 1,7-phenanthroline
Links:📏 NIST, 📖 PubMed
CAS:[230-46-6]
Formula:C12H8N2; 180.21 g/mol
InChiKey:OZKOMUDCMCEDTM-UHFFFAOYSA-N
SMILES:c1cnc2c(c1)ccc3ncccc23
Molecular structure of 1,7-phenanthroline
Dipole moment:2.06 D
Melting point:79 °C
Boiling point:360 °C
Log10 partition octanol / water:2.51

Isomers

benzo[c]cinnoline
Molecular structure of benzo[c]cinnoline
benzo[h]cinnoline
Molecular structure of benzo[h]cinnoline
2-(2,3-dihydroinden-1-ylidene)propanedinitrile
Molecular structure of 2-(2,3-dihydroinden-1-ylidene)propanedinitrile
1,10-phenanthroline
Molecular structure of 1,10-phenanthroline
1,7-phenanthroline
Molecular structure of 1,7-phenanthroline
4,7-phenanthroline
Molecular structure of 4,7-phenanthroline
phenazine
Molecular structure of phenazine
4-phenylpyridine-2-carbonitrile
Molecular structure of 4-phenylpyridine-2-carbonitrile
pyrido[3,2-γ]quinoline
Molecular structure of pyrido[3,2-g]quinoline