1,7-dichloronaphthalene


1,7-dichloronaphthalene
CAS:[2050-73-9]
Formula:C10H6Cl2; 197.06 g/mol
InChiKey:VQBIYCQGHAHVPN-UHFFFAOYSA-N
SMILES:Clc1ccc2cccc(Cl)c2c1
Molecular structure of 1,7-dichloronaphthalene
Density:1.261 g/mL
Molar volume:156.3 mL/mol
Dipole moment:2.57 D
Melting point:64 °C

Isomers

1,2-dichloronaphthalene
Molecular structure of 1,2-dichloronaphthalene
1,3-dichloronaphthalene
Molecular structure of 1,3-dichloronaphthalene
1,4-dichloronaphthalene
Molecular structure of 1,4-dichloronaphthalene
1,5-dichloronaphthalene
Molecular structure of 1,5-dichloronaphthalene
1,6-dichloronaphthalene
Molecular structure of 1,6-dichloronaphthalene
1,7-dichloronaphthalene
Molecular structure of 1,7-dichloronaphthalene
1,8-dichloronaphthalene
Molecular structure of 1,8-dichloronaphthalene
2,3-dichloronaphthalene
Molecular structure of 2,3-dichloronaphthalene
2,6-dichloronaphthalene
Molecular structure of 2,6-dichloronaphthalene
2,7-dichloronaphthalene
Molecular structure of 2,7-dichloronaphthalene