1,4-dichloronaphthalene


1,4-dichloronaphthalene
CAS:[1825-31-6]
Formula:C10H6Cl2; 197.06 g/mol
InChiKey:JDPKCYMVSKDOGS-UHFFFAOYSA-N
SMILES:Clc1ccc(Cl)c2ccccc12
Molecular structure of 1,4-dichloronaphthalene
Density:1.300 g/mL
Molar volume:151.6 mL/mol
Refractive index:1.623
Molecular refractive power:53.45 mL/mol
Dipole moment:0.00 D
Melting point:68 °C
Log10 partition octanol / water:4.57

Isomers

1,2-dichloronaphthalene
Molecular structure of 1,2-dichloronaphthalene
1,3-dichloronaphthalene
Molecular structure of 1,3-dichloronaphthalene
1,4-dichloronaphthalene
Molecular structure of 1,4-dichloronaphthalene
1,5-dichloronaphthalene
Molecular structure of 1,5-dichloronaphthalene
1,6-dichloronaphthalene
Molecular structure of 1,6-dichloronaphthalene
1,7-dichloronaphthalene
Molecular structure of 1,7-dichloronaphthalene
1,8-dichloronaphthalene
Molecular structure of 1,8-dichloronaphthalene
2,3-dichloronaphthalene
Molecular structure of 2,3-dichloronaphthalene
2,6-dichloronaphthalene
Molecular structure of 2,6-dichloronaphthalene
2,7-dichloronaphthalene
Molecular structure of 2,7-dichloronaphthalene