1,4-dichlorobicyclo[2.2.1]heptane


1,4-dichlorobicyclo[2.2.1]heptane; 1,4-dichloronorbornane
Links:🕷 ChemSpider
CAS:[2941-51-7]
Formula:C7H10Cl2; 165.06 g/mol
InChiKey:YBNBENMSAFGIQF-UHFFFAOYSA-N
SMILES:ClC12CCC(Cl)(CC1)C2
Molecular structure of 1,4-dichlorobicyclo[2.2.1]heptane
Dipole moment:1.32 D