1,4-dichloro-2-nitrobenzene


1,4-dichloro-2-nitrobenzene; 2,5-dichloronitrobenzene
Links:📏 NIST, 📖 PubMed
CAS:[89-61-2]
Formula:C6H3Cl2NO2; 192.00 g/mol
InChiKey:RZKKOBGFCAHLCZ-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cc(Cl)ccc1Cl
Molecular structure of 1,4-dichloro-2-nitrobenzene
Density:1.600 g/mL
Molar volume:120.0 mL/mol
Dipole moment:3.48 D
Melting point:55 °C
Boiling point:267 °C
Log10 partition octanol / water:3.03

Isomers

2,5-dichloronicotinic acid
Molecular structure of 2,5-dichloronicotinic acid
2,6-dichloronicotinic acid
Molecular structure of 2,6-dichloronicotinic acid
1,2-dichloro-3-nitrobenzene
Molecular structure of 1,2-dichloro-3-nitrobenzene
1,2-dichloro-4-nitrobenzene
Molecular structure of 1,2-dichloro-4-nitrobenzene
1,3-dichloro-2-nitrobenzene
Molecular structure of 1,3-dichloro-2-nitrobenzene
1,3-dichloro-5-nitrobenzene
Molecular structure of 1,3-dichloro-5-nitrobenzene
1,4-dichloro-2-nitrobenzene
Molecular structure of 1,4-dichloro-2-nitrobenzene
2,4-dichloro-1-nitrobenzene
Molecular structure of 2,4-dichloro-1-nitrobenzene
2,3-dichloropyridine-4-carboxylic acid
Molecular structure of 2,3-dichloropyridine-4-carboxylic acid
2,4-dichloropyridine-3-carboxylic acid
Molecular structure of 2,4-dichloropyridine-3-carboxylic acid
2,5-dichloropyridine-4-carboxylic acid
Molecular structure of 2,5-dichloropyridine-4-carboxylic acid
2,6-dichloropyridine-4-carboxylic acid
Molecular structure of 2,6-dichloropyridine-4-carboxylic acid
3,5-dichloropyridine-4-carboxylic acid
Molecular structure of 3,5-dichloropyridine-4-carboxylic acid
3,6-dichloropyridine-2-carboxylic acid
Molecular structure of 3,6-dichloropyridine-2-carboxylic acid
5,6-dichloropyridine-3-carboxylic acid
Molecular structure of 5,6-dichloropyridine-3-carboxylic acid