1,4-dichloro-2,5-dimethylbenzene


1,4-dichloro-2,5-dimethylbenzene; 2,5-dichloro-p-xylene
Links:📏 NIST
CAS:[1124-05-6]
Formula:C8H8Cl2; 175.06 g/mol
InChiKey:UTGSRNVBAFCOEU-UHFFFAOYSA-N
SMILES:Cc1cc(Cl)c(C)cc1Cl
Molecular structure of 1,4-dichloro-2,5-dimethylbenzene
Dipole moment:0.00 D
Melting point:69 °C
Boiling point:222 °C

Isomers

1,2-bis(chloromethyl)benzene
Molecular structure of 1,2-bis(chloromethyl)benzene
1,3-bis(chloromethyl)benzene
Molecular structure of 1,3-bis(chloromethyl)benzene
1,4-bis(chloromethyl)benzene
Molecular structure of 1,4-bis(chloromethyl)benzene
2-chloro-1-(4-chlorophenyl)ethane
Molecular structure of 2-chloro-1-(4-chlorophenyl)ethane
1,4-dichloro-2,5-dimethylbenzene
Molecular structure of 1,4-dichloro-2,5-dimethylbenzene
1,2-dichloro-3-ethylbenzene
Molecular structure of 1,2-dichloro-3-ethylbenzene
1,2-dichloro-4-ethylbenzene
Molecular structure of 1,2-dichloro-4-ethylbenzene
1,4-dichloro-2-ethylbenzene
Molecular structure of 1,4-dichloro-2-ethylbenzene
1-dichloromethyl-4-methylbenzene
Molecular structure of 1-dichloromethyl-4-methylbenzene