1,4-dibutoxybenzene


1,4-dibutoxybenzene; hydroquinone dibutyl ether; quinol dibutyl ether
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[104-36-9]
Formula:C14H22O2; 222.33 g/mol
InChiKey:ZROGCHDPRZRKTI-UHFFFAOYSA-N
SMILES:CCCCOc1ccc(OCCCC)cc1
Molecular structure of 1,4-dibutoxybenzene
Dipole moment:1.79 D
Melting point:46 °C

Isomers

4,4'-benzene-1,4-diyldibutan-2-ol
Molecular structure of 4,4'-benzene-1,4-diyldibutan-2-ol
1,4-dibutoxybenzene
Molecular structure of 1,4-dibutoxybenzene
3,5-di-tert-butylbenzene-1,2-diol
Molecular structure of 3,5-di-tert-butylbenzene-1,2-diol
2,5-di-tert-butylhydroquinone
Molecular structure of 2,5-di-tert-butylhydroquinone
4,6-di-tert-butylresorcinol
Molecular structure of 4,6-di-tert-butylresorcinol
2,2-dimethyl-3-p-isopropylphenyl-1,3-propanediol
Molecular structure of 2,2-dimethyl-3-p-isopropylphenyl-1,3-propanediol
isobornyl methacrylate
Molecular structure of isobornyl methacrylate
4-octoxyphenol
Molecular structure of 4-octoxyphenol
1-phenyl-2-propyl-1,2-pentanediol
Molecular structure of 1-phenyl-2-propyl-1,2-pentanediol
(1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate
Molecular structure of (1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate