1,4-dibromo-2,5-dimethylbenzene


1,4-dibromo-2,5-dimethylbenzene; 2,5-dibromo-p-xylene
Links:📏 NIST
CAS:[1074-24-4]
Formula:C8H8Br2; 263.96 g/mol
InChiKey:QENIALCDPFDFHX-UHFFFAOYSA-N
SMILES:Cc1cc(Br)c(C)cc1Br
Molecular structure of 1,4-dibromo-2,5-dimethylbenzene
Dipole moment:0.00 D
Melting point:73 °C
Boiling point:261 °C

Isomers

1,2-bis(bromomethyl)benzene
Molecular structure of 1,2-bis(bromomethyl)benzene
1,3-bis(bromomethyl)benzene
Molecular structure of 1,3-bis(bromomethyl)benzene
1,4-bis(bromomethyl)benzene
Molecular structure of 1,4-bis(bromomethyl)benzene
3-bromophenethyl bromide
Molecular structure of 3-bromophenethyl bromide
4-bromophenethyl bromide
Molecular structure of 4-bromophenethyl bromide
1,2-dibromo-4,5-dimethylbenzene
Molecular structure of 1,2-dibromo-4,5-dimethylbenzene
1,4-dibromo-2,5-dimethylbenzene
Molecular structure of 1,4-dibromo-2,5-dimethylbenzene
1,5-dibromo-2,4-dimethylbenzene
Molecular structure of 1,5-dibromo-2,4-dimethylbenzene
(1,2-dibromoethyl)benzene
Molecular structure of (1,2-dibromoethyl)benzene
1-dibromomethyl-2-methylbenzene
Molecular structure of 1-dibromomethyl-2-methylbenzene
1-dibromomethyl-3-methylbenzene
Molecular structure of 1-dibromomethyl-3-methylbenzene
1-dibromomethyl-4-methylbenzene
Molecular structure of 1-dibromomethyl-4-methylbenzene