1,3-dibromo-2-methoxy-5-methylbenzene


1,3-dibromo-2-methoxy-5-methylbenzene; 2,6-dibromo-4-methylanisole
CAS:[51699-89-9]
Formula:C8H8Br2O; 279.96 g/mol
InChiKey:IHOLQYYMMKYVLH-UHFFFAOYSA-N
SMILES:COc1c(Br)cc(C)cc1Br
Molecular structure of 1,3-dibromo-2-methoxy-5-methylbenzene
Dipole moment:2.55 D