1,3-dibenzoylbenzene


m-dibenzoylbenzene; 1,3-dibenzoylbenzene
CAS:[3770-82-9]
Formula:C20H14O2; 286.33 g/mol
InChiKey:MJQHDSIEDGPFAM-UHFFFAOYSA-N
SMILES:O=C(c1ccccc1)c2cccc(c2)C(=O)c3ccccc3
Molecular structure of 1,3-dibenzoylbenzene
Dipole moment:3.59 D
Melting point:99 °C

Isomers

2,2'-binaphthalene-1,1'-diol
Molecular structure of 2,2'-binaphthalene-1,1'-diol
1,2-dibenzoylbenzene
Molecular structure of 1,2-dibenzoylbenzene
1,3-dibenzoylbenzene
Molecular structure of 1,3-dibenzoylbenzene
1,4-dibenzoylbenzene
Molecular structure of 1,4-dibenzoylbenzene
1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethane-1,2-dione
Molecular structure of 1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethane-1,2-dione
3,3-diphenyl-1(3~H)-isobenzofuranone
Molecular structure of 3,3-diphenyl-1(3H)-isobenzofuranone
1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol
Molecular structure of 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol
2-tetracen-1-ylacetic acid
Molecular structure of 2-tetracen-1-ylacetic acid