1,3-diacetylbenzene


m-acetylacetophenone; 1-(3-acetylphenyl)ethanone; m-diacetylbenzene; 1,3-diacetylbenzene; 1,1'-(1,3-phenylene)diethanone
Links:📏 NIST, 📖 PubMed
CAS:[6781-42-6]
Formula:C10H10O2; 162.19 g/mol
InChiKey:VCHOFVSNWYPAEF-UHFFFAOYSA-N
SMILES:CC(=O)c1cccc(c1)C(C)=O
Molecular structure of 1,3-diacetylbenzene
Dipole moment:3.19 D
Melting point:32 °C
Log10 partition octanol / water:1.43

Isomers

5-acetyl-2,3-dihydrobenzo[b]furan
Molecular structure of 5-acetyl-2,3-dihydrobenzo[b]furan
allyl benzoate
Molecular structure of allyl benzoate
1-allyl-3,4-methylendioxybenzene
Molecular structure of 1-allyl-3,4-methylendioxybenzene
2-allyloxybenzaldehyde
Molecular structure of 2-allyloxybenzaldehyde
4-allyloxybenzaldehyde
Molecular structure of 4-allyloxybenzaldehyde
3-allylsalicylaldehyde
Molecular structure of 3-allylsalicylaldehyde
benzoylacetone
Molecular structure of benzoylacetone
benzyl acrylate
Molecular structure of benzyl acrylate
bicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate
Molecular structure of bicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate
1,2-diacetylbenzene
Molecular structure of 1,2-diacetylbenzene
1,3-diacetylbenzene
Molecular structure of 1,3-diacetylbenzene
1,4-diacetylbenzene
Molecular structure of 1,4-diacetylbenzene
3,3-dimethyl-2-benzofuran-1(3H)-one
Molecular structure of 3,3-dimethyl-2-benzofuran-1(3H)-one
4,6-dimethyl-1-benzofuran-2(3H)-one
Molecular structure of 4,6-dimethyl-1-benzofuran-2(3H)-one
4,7-dimethyl-2-benzofuran-1(3H)-one
Molecular structure of 4,7-dimethyl-2-benzofuran-1(3H)-one
(4-ethenylphenyl) acetate
Molecular structure of (4-ethenylphenyl) acetate
4-ethenylphenyl acetate
Molecular structure of 4-ethenylphenyl acetate
3-ethyl-1(3H)-isobenzofuranone
Molecular structure of 3-ethyl-1(3H)-isobenzofuranone
1-ethynyl-3,5-dimethoxybenzene
Molecular structure of 1-ethynyl-3,5-dimethoxybenzene
6-hydroxy-3,4-dihydro-1(2H)-naphthalenone
Molecular structure of 6-hydroxy-3,4-dihydro-1(2H)-naphthalenone
7-hydroxy-4-methyl-1-indanone
Molecular structure of 7-hydroxy-4-methyl-1-indanone
7-hydroxy-6-methyl-1-indanone
Molecular structure of 7-hydroxy-6-methyl-1-indanone
5-hydroxy-1-tetralone
Molecular structure of 5-hydroxy-1-tetralone
4-methoxy-1-indanone
Molecular structure of 4-methoxy-1-indanone
5-methoxy-1-indanone
Molecular structure of 5-methoxy-1-indanone
6-methoxy-1-indanone
Molecular structure of 6-methoxy-1-indanone
7-methoxy-1-indanone
Molecular structure of 7-methoxy-1-indanone
3-methoxy-4-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 3-methoxy-4-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
3-methoxy-5-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 3-methoxy-5-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
5-methoxy-3-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 5-methoxy-3-methylbicyclo[4.2.0]octa-1,3,5-trien-7-one
(E)-3-(2-methoxyphenyl)prop-2-enal
Molecular structure of (E)-3-(2-methoxyphenyl)prop-2-enal
(E)-3-(4-methoxyphenyl)prop-2-enal
Molecular structure of (E)-3-(4-methoxyphenyl)prop-2-enal
6-methyl-4-chromanone
Molecular structure of 6-methyl-4-chromanone
methyl cinnamate
Molecular structure of methyl cinnamate
methyl 4-ethenylbenzoate
Molecular structure of methyl 4-ethenylbenzoate
methyl (Z)-3-phenyl-2-propenoate
Molecular structure of methyl (Z)-3-phenyl-2-propenoate
(E)-2-methyl-3-phenylprop-2-enoic acid
Molecular structure of (E)-2-methyl-3-phenylprop-2-enoic acid
(2E)-3-(2-methylphenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(2-methylphenyl)prop-2-enoic acid
(2E)-3-(3-methylphenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(3-methylphenyl)prop-2-enoic acid
(2E)-3-(4-methylphenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(4-methylphenyl)prop-2-enoic acid
(E)-4-phenyl-3-butenoic acid
Molecular structure of (E)-4-phenyl-3-butenoic acid
1-phenylcyclopropanecarboxylic acid
Molecular structure of 1-phenylcyclopropanecarboxylic acid
trans-2-phenylcyclopropane-1-carboxylic acid
Molecular structure of trans-2-phenylcyclopropane-1-carboxylic acid
phenyl methacrylate
Molecular structure of phenyl methacrylate
5-phenyloxolan-2-one
Molecular structure of 5-phenyloxolan-2-one
(E)-3-phenyl-2-propen-1-yl formate
Molecular structure of (E)-3-phenyl-2-propen-1-yl formate
1-phenylvinyl acetate
Molecular structure of 1-phenylvinyl acetate
2-prop-2-en-1-ylbenzoic acid
Molecular structure of 2-prop-2-en-1-ylbenzoic acid
1-propenyl-3,4-methylenedioxybenzene
Molecular structure of 1-propenyl-3,4-methylenedioxybenzene