1,3-butanediol dinitrate


1,3-butanediol dinitrate; 4-nitrooxybutan-2-yl nitrate
Links:📏 NIST
CAS:[6423-44-5]
Formula:C4H8N2O6; 180.12 g/mol
InChiKey:QNCKJGHWFQLXOX-UHFFFAOYSA-N
SMILES:O=N(=O)OCCC(ON(=O)=O)C
Molecular structure of 1,3-butanediol dinitrate
Density:1.317 g/mL
Molar volume:136.8 mL/mol
Refractive index:1.433
Molecular refractive power:35.52 mL/mol
Dielectric constant:18.90
Dipole moment:3.45 D
Viscosity:6.00 cP

Isomers

1,3-butanediol dinitrate
Molecular structure of 1,3-butanediol dinitrate
2,3-butanediol dinitrate
Molecular structure of 2,3-butanediol dinitrate
1-nitrooxybutan-2-yl nitrate
Molecular structure of 1-nitrooxybutan-2-yl nitrate
tetramethylene dinitrate
Molecular structure of tetramethylene dinitrate