1,3-bis(acetyloxy)-1,1,3,3-tetrabutyldistannoxane


1,3-bis(acetyloxy)-1,1,3,3-tetrabutyldistannoxane; 1,3-diacetoxy-1,1,3,3-tetrabutyldistannoxane; tetrabutyldistannoxane diacetate
CAS:[5967-09-9]
Formula:C20H42O5Sn2; 599.97 g/mol
InChiKey:JLHADLTXDDGZFX-UHFFFAOYSA-L
SMILES:CCCC[Sn](CCCC)(OC(C)=O)O[Sn](CCCC)(CCCC)OC(C)=O
Molecular structure of 1,3-bis(acetyloxy)-1,1,3,3-tetrabutyldistannoxane
Dipole moment:2.87 D
Melting point:57 °C