1,1,2-trichloro-1,2,2-trifluoroethane


freon 113; R-113; 1,1,2-trichlorotrifluoroethane; 1,1,2-trichloro-1,2,2-trifluoroethane; 1,2,2-trichloro-1,1,2-trifluoroethane
Links:📏 NIST, 📖 PubMed
CAS:[76-13-1]
Formula:C2Cl3F3; 187.38 g/mol
InChiKey:AJDIZQLSFPQPEY-UHFFFAOYSA-N
SMILES:FC(F)(C(F)(Cl)Cl)Cl.
Molecular structure of 1,1,2-trichloro-1,2,2-trifluoroethane
Density:1.564 g/mL
Molar volume:119.8 mL/mol
Refractive index:1.356
Molecular refractive power:26.16 mL/mol
Dielectric constant:2.41
Dipole moment:0.86 D
Melting point:-35 °C
Boiling point:48 °C
Vapour pressure:284 Torr
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Viscosity:0.71 cP
Critical temperature:214 °C
Critical pressure:33.7 atm
Critical volume:304.00 ml/mol
Log10 partition octanol / water:3.16
Snyder P':0.0
Dimroth ET:33.2
Hildebrant solubility parameter (δ):7.2
Hansen solubility parameter:δd: 7.2 (cal/ml)^0.5   δp: 0.8 (cal/ml)^0.5   δh: 0.0 (cal/ml)^0.5

Isomers

1,1,1-trichlorotrifluoroethane
Molecular structure of 1,1,1-trichlorotrifluoroethane
1,1,2-trichloro-1,2,2-trifluoroethane
Molecular structure of 1,1,2-trichloro-1,2,2-trifluoroethane