(2S,5R)-2-isopropyl-5-methylcyclohexanone


(2S,5R)-2-isopropyl-5-methylcyclohexanone; (1R,4S)-p-menthan-3-one; l-3-p-menthanone; (-)-menthone; l-menthone; menthone; (2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-one; (2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one
Links:🌍 Wikipedia, 📖 PubMed
CAS:[14073-97-3]
Formula:C10H18O; 154.25 g/mol
InChiKey:NFLGAXVYCFJBMK-BDAKNGLRSA-N
SMILES:CC(C)[C@@H]1CC[C@@H](C)CC1=O
Molecular structure of (2S,5R)-2-isopropyl-5-methylcyclohexanone
Use:peppermint flavors
Density:0.893 g/mL
Molar volume:172.7 mL/mol
Refractive index:1.451
Molecular refractive power:46.47 mL/mol
Dielectric constant:8.80
Dipole moment:2.80 D
Melting point:-6 °C
Boiling point:209 °C
Log10 partition octanol / water:3.05

Isomers

borneol
Molecular structure of borneol
l-borneol
Molecular structure of l-borneol
d-borneol
Molecular structure of d-borneol
4-tert-butylcyclohexanone
Molecular structure of 4-tert-butylcyclohexanone
4-carvomenthenol
Molecular structure of 4-carvomenthenol
1,4-cineol
Molecular structure of 1,4-cineol
(-)-citronellal
Molecular structure of (-)-citronellal
cyclodecanone
Molecular structure of cyclodecanone
α-cyclogeraniol
Molecular structure of a-cyclogeraniol
2-cyclopentylcyclopentanol
Molecular structure of 2-cyclopentylcyclopentanol
trans,trans-2,4-decadien-1-ol
Molecular structure of trans,trans-2,4-decadien-1-ol
cis-decahydro-1-naphthol
Molecular structure of cis-decahydro-1-naphthol
trans-2-decenal
Molecular structure of trans-2-decenal
cis-4-decenal
Molecular structure of cis-4-decenal
trans-4-decenal
Molecular structure of trans-4-decenal
cis-7-decenal
Molecular structure of cis-7-decenal
(E)-dec-3-en-2-one
Molecular structure of (E)-dec-3-en-2-one
2-decyn-1-ol
Molecular structure of 2-decyn-1-ol
3-decyn-1-ol
Molecular structure of 3-decyn-1-ol
5-decyn-1-ol
Molecular structure of 5-decyn-1-ol
(+)-dihydrocarveol
Molecular structure of (+)-dihydrocarveol
(-)-dihydrocarveol
Molecular structure of (-)-dihydrocarveol
(E)-3,7-dimethyloct-5-enal
Molecular structure of (E)-3,7-dimethyloct-5-enal
(3R)-3,7-dimethyloct-6-enal
Molecular structure of (3R)-3,7-dimethyloct-6-enal
3,7-dimethyloct-6-enal
Molecular structure of 3,7-dimethyloct-6-enal
3,7-dimethyl-7-octenal
Molecular structure of 3,7-dimethyl-7-octenal
4,7-dimethyloct-6-en-3-one
Molecular structure of 4,7-dimethyloct-6-en-3-one
(R)-1,2-epoxy-9-decene
Molecular structure of (R)-1,2-epoxy-9-decene
1,2-epoxy-9-decene
Molecular structure of 1,2-epoxy-9-decene
geraniol
Molecular structure of geraniol
grandisol
Molecular structure of grandisol
isoborneol
Molecular structure of isoborneol
isogeraniol
Molecular structure of isogeraniol
(1R,2R,3R,5S)-(-)-isopinocampheol
Molecular structure of (1R,2R,3R,5S)-(-)-isopinocampheol
(2S,5R)-2-isopropyl-5-methylcyclohexanone
Molecular structure of (2S,5R)-2-isopropyl-5-methylcyclohexanone
(+)-isopulegol
Molecular structure of (+)-isopulegol
(-)-isopulegol
Molecular structure of (-)-isopulegol
(-)-linalool
Molecular structure of (-)-linalool
linalool
Molecular structure of linalool
d-linalool
Molecular structure of d-linalool
(+)-menthone
Molecular structure of (+)-menthone
(R)-2-(4-methyl-3-cyclohexenyl)isopropanol
Molecular structure of (R)-2-(4-methyl-3-cyclohexenyl)isopropanol
2-(4-methyl-cyclohex-3-enyl)propan-2-ol
Molecular structure of 2-(4-methyl-cyclohex-3-enyl)propan-2-ol
2-methyl-6-methylideneoct-7-en-2-ol
Molecular structure of 2-methyl-6-methylideneoct-7-en-2-ol
3-methyl-1-nonyn-3-ol
Molecular structure of 3-methyl-1-nonyn-3-ol
nerol
Molecular structure of nerol
trans-2-pinanol
Molecular structure of trans-2-pinanol
cis-pinene hydrate
Molecular structure of cis-pinene hydrate
4-propyl-1,6-heptadien-4-ol
Molecular structure of 4-propyl-1,6-heptadien-4-ol
sabinene hydrate
Molecular structure of sabinene hydrate
α-terpineol
Molecular structure of a-terpineol
β-terpineol
Molecular structure of b-terpineol
γ-terpineol
Molecular structure of g-terpineol
2,2,5,5-tetramethylcyclohexanone
Molecular structure of 2,2,5,5-tetramethylcyclohexanone
3,3,5,5-tetramethylcyclohexanone
Molecular structure of 3,3,5,5-tetramethylcyclohexanone
(1R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol
Molecular structure of (1R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol
(1S)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol
Molecular structure of (1S)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol
(1S,2S,3S,5R)-2,7,7-trimethylbicyclo[3.1.1]heptan-3-ol
Molecular structure of (1S,2S,3S,5R)-2,7,7-trimethylbicyclo[3.1.1]heptan-3-ol
1,3,3-trimethyl-2-methylidenecyclohexan-1-ol
Molecular structure of 1,3,3-trimethyl-2-methylidenecyclohexan-1-ol
1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
Molecular structure of 1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
2,2,6-trimethyl-6-vinyltetrahydro-2H-pyran
Molecular structure of 2,2,6-trimethyl-6-vinyltetrahydro-2H-pyran