tris(4-methoxyphenyl)phosphine


tris(4-methoxyphenyl)phosphine
Links:📖 PubMed
CAS:[855-38-9]
Formula:C21H21O3P; 352.37 g/mol
InChiKey:UYUUAUOYLFIRJG-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)P(c2ccc(OC)cc2)c3ccc(OC)cc3
Molecular structure of tris(4-methoxyphenyl)phosphine
Melting point:131 °C

Isomers

tris(2-methoxyphenyl)phosphine
Molecular structure of tris(2-methoxyphenyl)phosphine
tris(3-methoxyphenyl)phosphine
Molecular structure of tris(3-methoxyphenyl)phosphine
tris(4-methoxyphenyl)phosphine
Molecular structure of tris(4-methoxyphenyl)phosphine
tris(2-methylphenyl) phosphite
Molecular structure of tris(2-methylphenyl) phosphite
tris(3-methylphenyl) phosphite
Molecular structure of tris(3-methylphenyl) phosphite
tris(4-methylphenyl) phosphite
Molecular structure of tris(4-methylphenyl) phosphite