tris(3-methylphenyl)phosphane


tris(3-methylphenyl)phosphane; tri(m-tolyl)phosphine
CAS:[6224-63-1]
Formula:C21H21P; 304.37 g/mol
InChiKey:LFNXCUNDYSYVJY-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)P(c2cccc(C)c2)c3cccc(C)c3
Molecular structure of tris(3-methylphenyl)phosphane
Melting point:100 °C

Isomers

tribenzylphosphine
Molecular structure of tribenzylphosphine
tris(3-methylphenyl)phosphane
Molecular structure of tris(3-methylphenyl)phosphane
tris(4-methylphenyl)phosphane
Molecular structure of tris(4-methylphenyl)phosphane
tris(2-methylphenyl)phosphine
Molecular structure of tris(2-methylphenyl)phosphine