methylidenecyclobutane


methylenecyclobutane; methylidenecyclobutane
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[1120-56-5]
Formula:C5H8; 68.12 g/mol
InChiKey:QIRVGKYPAOQVNP-UHFFFAOYSA-N
SMILES:[CH2]=[C]1C[CH2]C1
Molecular structure of methylidenecyclobutane
Density:0.739 g/mL
Molar volume:92.2 mL/mol
Refractive index:1.424
Molecular refractive power:23.51 mL/mol
Dipole moment:0.51 D
Melting point:-135 °C
Boiling point:42 °C

Isomers

cyclopentene
Molecular structure of cyclopentene
3,3-dimethylcyclopropene
Molecular structure of 3,3-dimethylcyclopropene
ethylidenecyclopropane
Molecular structure of ethylidenecyclopropane
isoprene
Molecular structure of isoprene
3-methyl-1,2-butadiene
Molecular structure of 3-methyl-1,2-butadiene
3-methyl-1-butyne
Molecular structure of 3-methyl-1-butyne
1-methylcyclobutene
Molecular structure of 1-methylcyclobutene
3-methylcyclobutene
Molecular structure of 3-methylcyclobutene
methylidenecyclobutane
Molecular structure of methylidenecyclobutane
1,2-pentadiene
Molecular structure of 1,2-pentadiene
(E)-1,3-pentadiene
Molecular structure of (E)-1,3-pentadiene
(Z)-1,3-pentadiene
Molecular structure of (Z)-1,3-pentadiene
1,4-pentadiene
Molecular structure of 1,4-pentadiene
2,3-pentadiene
Molecular structure of 2,3-pentadiene
1-pentyne
Molecular structure of 1-pentyne
2-pentyne
Molecular structure of 2-pentyne
spiropentane
Molecular structure of spiropentane
vinylcyclopropane
Molecular structure of vinylcyclopropane