gluconolactone


gluconolactone; D-glucono-1,5-lactone
CAS:[90-80-2]
Formula:C6H10O6; 178.14 g/mol
InChiKey:PHOQVHQSTUBQQK-SQOUGZDYSA-N
SMILES:OC[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O
Molecular structure of gluconolactone
Melting point:160 °C

Isomers

Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
diethyl peroxydicarbonate
Molecular structure of diethyl peroxydicarbonate
dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
dimethyl (R*,R*)-tartrate
Molecular structure of dimethyl (R*,R*)-tartrate
2,2'-[ethylenebis(oxy)] bisacetic acid
Molecular structure of 2,2'-[ethylenebis(oxy)] bisacetic acid
gluconolactone
Molecular structure of gluconolactone
D-gulonic acid γ-lactone
Molecular structure of D-gulonic acid g-lactone
L-gulonic acid γ-lactone
Molecular structure of L-gulonic acid g-lactone