fepradinol


fepradinol; 2-[(2-hydroxy-2-phenylethyl)amino]-2-methylpropan-1-ol
Links:🕷 ChemSpider
MeSH:Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Sensory System Agents
Formula:C12H19NO2; 209.29 g/mol
InChiKey:PVOOBRUZWPQOER-UHFFFAOYSA-N
SMILES:CC(C)(CO)NCC(O)c1ccccc1
Molecular structure of fepradinol

Isomers

bamethan
Molecular structure of bamethan
tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
Molecular structure of tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
N-(2,2-diethoxyethyl)aniline
Molecular structure of N-(2,2-diethoxyethyl)aniline
2,5-dimethoxy-4-methylamphetamine
Molecular structure of 2,5-dimethoxy-4-methylamphetamine
ethyl 2-cyano-3,3-dipropylacrylate
Molecular structure of ethyl 2-cyano-3,3-dipropylacrylate
fepradinol
Molecular structure of fepradinol
2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
Molecular structure of 2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
Molecular structure of 3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
octyl 2-cyanoprop-2-enoate
Molecular structure of octyl 2-cyanoprop-2-enoate
2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide
Molecular structure of 2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide