ethyl 2-cyano-3,3-dipropylacrylate


ethyl α-cyano-β,b-di-n-propylacrylate; ethyl α-cyano-β,b-dipropylacrylate; ethyl 2-cyano-3,3-dipropylacrylate
Formula:C12H19NO2; 209.29 g/mol
InChiKey:NRDOXUDRDLJJHT-UHFFFAOYSA-N
SMILES:CCCC(CCC)=C(C#N)C(=O)OCC
Molecular structure of ethyl 2-cyano-3,3-dipropylacrylate
Density:0.963 g/mL
Molar volume:217.3 mL/mol
Refractive index:1.468
Molecular refractive power:60.38 mL/mol
Surface tension:31.81 dyn/cm

Isomers

bamethan
Molecular structure of bamethan
tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
Molecular structure of tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
N-(2,2-diethoxyethyl)aniline
Molecular structure of N-(2,2-diethoxyethyl)aniline
2,5-dimethoxy-4-methylamphetamine
Molecular structure of 2,5-dimethoxy-4-methylamphetamine
ethyl 2-cyano-3,3-dipropylacrylate
Molecular structure of ethyl 2-cyano-3,3-dipropylacrylate
fepradinol
Molecular structure of fepradinol
2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
Molecular structure of 2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
Molecular structure of 3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
octyl 2-cyanoprop-2-enoate
Molecular structure of octyl 2-cyanoprop-2-enoate
2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide
Molecular structure of 2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide