diphenyl-4-pyridylmethane


diphenyl-4-pyridylmethane
CAS:[3678-72-6]
Formula:C18H15N; 245.32 g/mol
InChiKey:ZWLWOTHDIGRTNE-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c2ccccc2)c3ccncc3
Molecular structure of diphenyl-4-pyridylmethane
Melting point:125 °C

Isomers

11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
Molecular structure of 11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
2,6-diphenylaniline
Molecular structure of 2,6-diphenylaniline
diphenyl-4-pyridylmethane
Molecular structure of diphenyl-4-pyridylmethane
triphenylamine
Molecular structure of triphenylamine