diethyl (2S,3S)-2,3-dihydroxybutanedioate


diethyl (2S,3S)-2,3-dihydroxybutanedioate; diethyl δ-2,3-dihydroxybutanedioate; (-)-diethyl D-tartrate; (2S,3S)-(-)-diethyl tartrate; diethyl δ-tartrate; ethyl δ-tartrate; d-tartaric acid diethyl ester; d-tartaric acid ethyl ester
CAS:[13811-71-7]
Formula:C8H14O6; 206.20 g/mol
InChiKey:YSAVZVORKRDODB-WDSKDSINSA-N
SMILES:CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC
Molecular structure of diethyl (2S,3S)-2,3-dihydroxybutanedioate
Density:1.200 g/mL
Molar volume:171.8 mL/mol
Refractive index:1.445
Molecular refractive power:45.77 mL/mol
Melting point:17 °C
Boiling point:280 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:-0.29

Isomers

diethyl (2R,3R)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2R,3R)-2,3-dihydroxybutanedioate
diethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2S,3S)-2,3-dihydroxybutanedioate
diethyl (R,S)-tartarate
Molecular structure of diethyl (R,S)-tartarate
diethyl DL-tartrate
Molecular structure of diethyl DL-tartrate
diethyl (R*,R*)-tartrate
Molecular structure of diethyl (R*,R*)-tartrate
diisopropyl peroxydicarbonate
Molecular structure of diisopropyl peroxydicarbonate
dimethyl (R*,R*)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R*,R*)-2,3-dimethoxysuccinate
dimethyl (R,S)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R,S)-2,3-dimethoxysuccinate
4,6-O-ethylidene-α-D-glucose
Molecular structure of 4,6-O-ethylidene-a-D-glucose