cyclohexane-1,1-dicarboxylic acid


1,1-cyclohexanedicarboxylic acid; cyclohexane-1,1-dicarboxylic acid; cyclohexane-1:1-dicarboxylic acid
Links:📏 NIST
CAS:[1127-08-8]
Formula:C8H12O4; 172.18 g/mol
InChiKey:QYQADNCHXSEGJT-UHFFFAOYSA-N
SMILES:OC(=O)C1(CCCCC1)C(O)=O
Molecular structure of cyclohexane-1,1-dicarboxylic acid
Melting point:178 °C

Isomers

2-[(acetyloxy)methyl]prop-2-en-1-yl acetate
Molecular structure of 2-[(acetyloxy)methyl]prop-2-en-1-yl acetate
(2Z)-4-butoxy-4-oxobut-2-enoic acid
Molecular structure of (2Z)-4-butoxy-4-oxobut-2-enoic acid
cis-2-(2-carboxycyclopentyl)acetic acid
Molecular structure of cis-2-(2-carboxycyclopentyl)acetic acid
trans-2-(2-carboxycyclopentyl)acetic acid
Molecular structure of trans-2-(2-carboxycyclopentyl)acetic acid
cyclohexane-1,1-dicarboxylic acid
Molecular structure of cyclohexane-1,1-dicarboxylic acid
(1R,2R)-cyclohexane-1,2-dicarboxylic acid
Molecular structure of (1R,2R)-cyclohexane-1,2-dicarboxylic acid
cis-1,2-cyclohexanedicarboxylic acid
Molecular structure of cis-1,2-cyclohexanedicarboxylic acid
trans-cyclohexane-1,2-dicarboxylic acid
Molecular structure of trans-cyclohexane-1,2-dicarboxylic acid
(1S,3R)-cyclohexane-1,3-dicarboxylic acid
Molecular structure of (1S,3R)-cyclohexane-1,3-dicarboxylic acid
trans-cyclohexane-1,3-dicarboxylic acid
Molecular structure of trans-cyclohexane-1,3-dicarboxylic acid
trans-1,4-cyclohexanedicarboxylic acid
Molecular structure of trans-1,4-cyclohexanedicarboxylic acid
cis-1,4-diacetoxy-2-butene
Molecular structure of cis-1,4-diacetoxy-2-butene
3,4-diacetoxy-1-butene
Molecular structure of 3,4-diacetoxy-1-butene
diethyl (2E)-2-butenedioate
Molecular structure of diethyl (2E)-2-butenedioate
diethyl (2Z)-2-butenedioate
Molecular structure of diethyl (2Z)-2-butenedioate
(Z)-2,3-diethylbut-2-enedioic acid
Molecular structure of (Z)-2,3-diethylbut-2-enedioic acid
5,5-diethyl-1,3-dioxane-4,6-dione
Molecular structure of 5,5-diethyl-1,3-dioxane-4,6-dione
dimethyl cyclobutane-1,1-dicarboxylate
Molecular structure of dimethyl cyclobutane-1,1-dicarboxylate
cis-2,2-dimethylcyclobutane-1,3-dicarboxylic acid
Molecular structure of cis-2,2-dimethylcyclobutane-1,3-dicarboxylic acid
trans-2,2-dimethylcyclobutane-1,3-dicarboxylic acid
Molecular structure of trans-2,2-dimethylcyclobutane-1,3-dicarboxylic acid
2-(2,2-dimethyl-5-oxooxolan-3-yl)acetic acid
Molecular structure of 2-(2,2-dimethyl-5-oxooxolan-3-yl)acetic acid
dimethyl 2-prop-2-enylpropanedioate
Molecular structure of dimethyl 2-prop-2-enylpropanedioate
1-ethoxycarbonyl cyclobutane-1-carboxylic acid
Molecular structure of 1-ethoxycarbonyl cyclobutane-1-carboxylic acid
ethyl (Z)-3-acetoxy-2-butenoate
Molecular structure of ethyl (Z)-3-acetoxy-2-butenoate
ethyl 2-acetyl-3-oxobutanoate
Molecular structure of ethyl 2-acetyl-3-oxobutanoate
methyl 3-acetoxy-2-methylenebutyrate
Molecular structure of methyl 3-acetoxy-2-methylenebutyrate
3-methyl-2,5,6-trioxo-3-heptanol
Molecular structure of 3-methyl-2,5,6-trioxo-3-heptanol
(3αR,4S,5R,6αS)-(-)-hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[β]furan-2-one
Molecular structure of (3aR,4S,5R,6aS)-(-)-hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one
(3αS,4R,5S,6αR)-(+)-hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[β]furan-2-one
Molecular structure of (3aS,4R,5S,6aR)-(+)-hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one