citronellyl formate


citronellyl formate; 3,7-dimethyloct-6-enyl formate; 3,7-dimethyloct-6-en-1-yl formate
CAS:[105-85-1]
Formula:C11H20O2; 184.28 g/mol
InChiKey:DZNVIZQPWLDQHI-UHFFFAOYSA-N
SMILES:CC(CCOC=O)CCC=C(C)C
Molecular structure of citronellyl formate
Density:0.897 g/mL
Molar volume:205.4 mL/mol
Boiling point:235 °C

Isomers

allyl octanoate
Molecular structure of allyl octanoate
citronellyl formate
Molecular structure of citronellyl formate
cyclohexanepentanoic acid
Molecular structure of cyclohexanepentanoic acid
cyclohexyl isovalerate
Molecular structure of cyclohexyl isovalerate
1,1-diethoxyhept-2-yne
Molecular structure of 1,1-diethoxyhept-2-yne
ethenyl 6,6-dimethylheptanoate
Molecular structure of ethenyl 6,6-dimethylheptanoate
ethyl cycloheptylacetate
Molecular structure of ethyl cycloheptylacetate
2-ethylhexyl prop-2-enoate
Molecular structure of 2-ethylhexyl prop-2-enoate
ethyl (E)-2-nonenoate
Molecular structure of ethyl (E)-2-nonenoate
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-hexyldihydro-5-methyl-2(3~H)-furanone
Molecular structure of 5-hexyldihydro-5-methyl-2(3H)-furanone
6-hexyloxan-2-one
Molecular structure of 6-hexyloxan-2-one
hexyl tiglate
Molecular structure of hexyl tiglate
isooctyl acrylate
Molecular structure of isooctyl acrylate
(1S,2R,5S)-2-isopropyl-5-methylcyclohexyl formate
Molecular structure of (1S,2R,5S)-2-isopropyl-5-methylcyclohexyl formate
l-menthyl formate
Molecular structure of l-menthyl formate
menthyl formate
Molecular structure of menthyl formate
octyl acrylate
Molecular structure of octyl acrylate
oxacyclododecan-2-one
Molecular structure of oxacyclododecan-2-one
2,2,7,7-tetramethyl-1,6-dioxaspiro[4,4]nonane
Molecular structure of 2,2,7,7-tetramethyl-1,6-dioxaspiro[4,4]nonane
2,2,6,6-tetramethyl-3,5-heptanedione
Molecular structure of 2,2,6,6-tetramethyl-3,5-heptanedione
2,2,7-trimethyloctane-3,5-dione
Molecular structure of 2,2,7-trimethyloctane-3,5-dione
2,5-undecanedione
Molecular structure of 2,5-undecanedione
undec-10-enoic acid
Molecular structure of undec-10-enoic acid
trans-2-undecenoic acid
Molecular structure of trans-2-undecenoic acid