butyl oleate


butyl (Z)-octadec-9-enoate; butyl 9-octadecenoate; butyl oleate; oleic acid butyl ester
Links:📖 PubMed
CAS:[142-77-8]
Formula:C22H42O2; 338.57 g/mol
InChiKey:WIBFFTLQMKKBLZ-SEYXRHQNSA-N
SMILES:CCCCCCCCC=C/CCCCCCCC(=O)OCCCC
Molecular structure of butyl oleate
Density:0.868 g/mL
Molar volume:390.1 mL/mol
Dielectric constant:4.00
Melting point:-27 °C

Isomers

butyl oleate
Molecular structure of butyl oleate
(E)-docos-13-enoic acid
Molecular structure of (E)-docos-13-enoic acid
(Z)-docos-13-enoic acid
Molecular structure of (Z)-docos-13-enoic acid
octadecyl 2-methylprop-2-enoate
Molecular structure of octadecyl 2-methylprop-2-enoate