bis(4-hydroxyphenyl) sulfone


bis(4-hydroxyphenyl) sulfone; bisphenol S; 4-(4-hydroxybenzenesulfonyl)phenol; 4-(4-hydroxyphenyl)sulfonylphenol; 4,4'-sulfonylbisphenol; 4,4'-sulfonyldiphenol
Links:📖 PubMed
CAS:[80-09-1]
Formula:C12H10O4S; 250.28 g/mol
InChiKey:VPWNQTHUCYMVMZ-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)[S](=O)(=O)c2ccc(O)cc2
Molecular structure of bis(4-hydroxyphenyl) sulfone
Density:1.366 g/mL
Molar volume:183.2 mL/mol
Melting point:248 °C

Isomers

bis(4-hydroxyphenyl) sulfone
Molecular structure of bis(4-hydroxyphenyl) sulfone
2-(2-hydroxyphenyl)sulfonylphenol
Molecular structure of 2-(2-hydroxyphenyl)sulfonylphenol
2-(3-hydroxyphenyl)sulfonylphenol
Molecular structure of 2-(3-hydroxyphenyl)sulfonylphenol
3,3'-sulphonylbisphenol
Molecular structure of 3,3'-sulphonylbisphenol