N-tert-butyl-3,5-dimethylaniline


N-tert-butyl-3,5-dimethylaniline
CAS:[110993-40-3]
Formula:C12H19N; 177.29 g/mol
InChiKey:HMWHVIXDKZHDEO-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(NC(C)(C)C)c1
Molecular structure of N-tert-butyl-3,5-dimethylaniline
Density:0.901 g/mL
Molar volume:196.8 mL/mol

Isomers

N-tert-butyl-3,5-dimethylaniline
Molecular structure of N-tert-butyl-3,5-dimethylaniline
4-tert-butyl-N,N-dimethylaniline
Molecular structure of 4-tert-butyl-N,N-dimethylaniline
N,N-diisopropylaniline
Molecular structure of N,N-diisopropylaniline
2,6-diisopropylaniline
Molecular structure of 2,6-diisopropylaniline
N,N-dipropylaniline
Molecular structure of N,N-dipropylaniline
2-heptylpyridine
Molecular structure of 2-heptylpyridine
3-heptylpyridine
Molecular structure of 3-heptylpyridine
4-heptylpyridine
Molecular structure of 4-heptylpyridine
N-hexylaniline
Molecular structure of N-hexylaniline
4-hexylaniline
Molecular structure of 4-hexylaniline
isopropylamphetamine
Molecular structure of isopropylamphetamine
1-phenyl-2-amino-3,3-dimethylbutane
Molecular structure of 1-phenyl-2-amino-3,3-dimethylbutane
1-phenyl-2-aminohexane
Molecular structure of 1-phenyl-2-aminohexane
1-phenyl-2-amino-4-methylpentane
Molecular structure of 1-phenyl-2-amino-4-methylpentane
1-phenyl-N-propylpropan-2-amine
Molecular structure of 1-phenyl-N-propylpropan-2-amine
4-(1-propylbutyl)pyridine
Molecular structure of 4-(1-propylbutyl)pyridine
1-(3,4,5-trimethylphenyl)-2-aminopropane
Molecular structure of 1-(3,4,5-trimethylphenyl)-2-aminopropane