N,N'-diphenylurea


carbanilide; N,N'-diphenylurea; sym-diphenylurea; 1,3-diphenylurea
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenylharnstoff); p. 633
CAS:[102-07-8]
Formula:C13H12N2O; 212.25 g/mol
InChiKey:GWEHVDNNLFDJLR-UHFFFAOYSA-N
SMILES:O=C(Nc1ccccc1)Nc2ccccc2
Molecular structure of N,N'-diphenylurea
Density:1.239 g/mL
Molar volume:171.3 mL/mol
Dipole moment:4.60 D
Melting point:238 °C
Boiling point:262 °C
Log10 partition octanol / water:3.00

Isomers

2-aminobenzanilide
Molecular structure of 2-aminobenzanilide
4-aminobenzanilide
Molecular structure of 4-aminobenzanilide
4'-aminobenzanilide
Molecular structure of 4'-aminobenzanilide
2-[(2-aminophenyl)methylideneamino]phenol
Molecular structure of 2-[(2-aminophenyl)methylideneamino]phenol
1-biphenyl-4-ylurea
Molecular structure of 1-biphenyl-4-ylurea
bis(3-aminophenyl)methanone
Molecular structure of bis(3-aminophenyl)methanone
bis(4-aminophenyl)methanone
Molecular structure of bis(4-aminophenyl)methanone
3,4-diaminobenzophenone
Molecular structure of 3,4-diaminobenzophenone
3-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-ol
Molecular structure of 3-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-ol
N,N'-diphenylurea
Molecular structure of N,N'-diphenylurea
1,1-di(phenyl)urea
Molecular structure of 1,1-di(phenyl)urea
harmine
Molecular structure of harmine
2-hydroxybenzaldehyde phenylhydrazone
Molecular structure of 2-hydroxybenzaldehyde phenylhydrazone
(2-methoxyphenyl)phenyldiazene
Molecular structure of (2-methoxyphenyl)phenyldiazene
(4-methoxyphenyl)-phenyldiazene
Molecular structure of (4-methoxyphenyl)-phenyldiazene
3-methyl-4-(phenylazo)phenol
Molecular structure of 3-methyl-4-(phenylazo)phenol
4-methyl-2-(phenylazo)phenol
Molecular structure of 4-methyl-2-(phenylazo)phenol
N'-phenylbenzohydrazide
Molecular structure of N'-phenylbenzohydrazide
4-phenylbenzohydrazide
Molecular structure of 4-phenylbenzohydrazide