5-methyl-1-indanone


5-methyl-1-indanone
CAS:[4593-38-8]
Formula:C10H10O; 146.19 g/mol
InChiKey:KBHCTNGQJOEDDC-UHFFFAOYSA-N
SMILES:Cc1ccc2C(=O)CCc2c1
Molecular structure of 5-methyl-1-indanone
Melting point:71 °C

Isomers

benzyl propargyl ether
Molecular structure of benzyl propargyl ether
cyclopropyl-phenylmethanone
Molecular structure of cyclopropyl-phenylmethanone
3,4-dihydro-1H-naphthalen-2-one
Molecular structure of 3,4-dihydro-1H-naphthalen-2-one
3,4-dihydro-1(2~H)-naphthalenone
Molecular structure of 3,4-dihydro-1(2H)-naphthalenone
2,5-dimethylbenzofuran
Molecular structure of 2,5-dimethylbenzofuran
2,7-dimethylbenzofuran
Molecular structure of 2,7-dimethylbenzofuran
3,5-dimethylbenzofuran
Molecular structure of 3,5-dimethylbenzofuran
3,6-dimethylbenzofuran
Molecular structure of 3,6-dimethylbenzofuran
4,6-dimethylbenzofuran
Molecular structure of 4,6-dimethylbenzofuran
4,7-dimethylbenzofuran
Molecular structure of 4,7-dimethylbenzofuran
5,6-dimethylbenzofuran
Molecular structure of 5,6-dimethylbenzofuran
5,7-dimethylbenzofuran
Molecular structure of 5,7-dimethylbenzofuran
6,7-dimethylbenzofuran
Molecular structure of 6,7-dimethylbenzofuran
3,5-dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 3,5-dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-one
1-(4-ethenylphenyl)ethanone
Molecular structure of 1-(4-ethenylphenyl)ethanone
5-ethylbenzofuran
Molecular structure of 5-ethylbenzofuran
7-ethylbenzofuran
Molecular structure of 7-ethylbenzofuran
1-ethynyl-4-methoxy-2-methylbenzene
Molecular structure of 1-ethynyl-4-methoxy-2-methylbenzene
2-methyl-2,3-dihydro-1H-inden-1-one
Molecular structure of 2-methyl-2,3-dihydro-1H-inden-1-one
3-methyl-1-indanone
Molecular structure of 3-methyl-1-indanone
4-methyl-1-indanone
Molecular structure of 4-methyl-1-indanone
5-methyl-1-indanone
Molecular structure of 5-methyl-1-indanone
6-methyl-1-indanone
Molecular structure of 6-methyl-1-indanone
2-methyl-1H-inden-1-ol
Molecular structure of 2-methyl-1H-inden-1-ol
3-methyl-1H-inden-1-ol
Molecular structure of 3-methyl-1H-inden-1-ol
(E)-2-methyl-3-phenylprop-2-enal
Molecular structure of (E)-2-methyl-3-phenylprop-2-enal
(E)-1-phenyl-2-buten-1-one
Molecular structure of (E)-1-phenyl-2-buten-1-one
(E)-4-phenyl-3-buten-2-one
Molecular structure of (E)-4-phenyl-3-buten-2-one
(Z)-4-phenylbut-3-en-2-one
Molecular structure of (Z)-4-phenylbut-3-en-2-one
1-phenyl-1-butyn-3-ol
Molecular structure of 1-phenyl-1-butyn-3-ol
2-phenyl-3-butyn-2-ol
Molecular structure of 2-phenyl-3-butyn-2-ol