4-methylphenyl (E)-2-ethyl-2-butenoate


4-methylphenyl (E)-2-ethyl-2-butenoate; p-tolyl α-ethylcrotonate
Formula:C13H16O2; 204.27 g/mol
InChiKey:MLBOBNIJUZMPRQ-NYYWCZLTSA-N
SMILES:CCC(=C/C)C(=O)Oc1ccc(C)cc1
Molecular structure of 4-methylphenyl (E)-2-ethyl-2-butenoate
Density:1.013 g/mL
Molar volume:201.6 mL/mol
Refractive index:1.516
Molecular refractive power:60.85 mL/mol

Isomers

n-butyl cinnamate
Molecular structure of n-butyl cinnamate
(E)-cinnamyl isobutyrate
Molecular structure of (E)-cinnamyl isobutyrate
cyclohexyl benzoate
Molecular structure of cyclohexyl benzoate
2-cyclohexylbenzoic acid
Molecular structure of 2-cyclohexylbenzoic acid
4-cyclohexylbenzoic acid
Molecular structure of 4-cyclohexylbenzoic acid
cyclopentylphenylacetic acid
Molecular structure of cyclopentylphenylacetic acid
1,3-diacetyl-2,4,6-trimethylbenzene
Molecular structure of 1,3-diacetyl-2,4,6-trimethylbenzene
3,3-diethoxy-1-phenylpropyne
Molecular structure of 3,3-diethoxy-1-phenylpropyne
3,4-dimethyl-2-ethyl-7-hydroxy-1-indanone
Molecular structure of 3,4-dimethyl-2-ethyl-7-hydroxy-1-indanone
4,4-dimethyl-1-phenylpentane-1,3-dione
Molecular structure of 4,4-dimethyl-1-phenylpentane-1,3-dione
3-ethyl-2,3-dihydro-2,6-dimethyl-1-benzopyran-4-one
Molecular structure of 3-ethyl-2,3-dihydro-2,6-dimethyl-1-benzopyran-4-one
ethyl (E)-2,3-dimethyl-3-phenyl-2-propenoate
Molecular structure of ethyl (E)-2,3-dimethyl-3-phenyl-2-propenoate
ethyl (E)-2-ethyl-3-phenyl-2-propenoate
Molecular structure of ethyl (E)-2-ethyl-3-phenyl-2-propenoate
cis-3-hexenyl benzoate
Molecular structure of cis-3-hexenyl benzoate
(1-hydroxycyclohexyl)-phenylmethanone
Molecular structure of (1-hydroxycyclohexyl)-phenylmethanone
2-(3-methoxyphenyl)cyclohexanone
Molecular structure of 2-(3-methoxyphenyl)cyclohexanone
4-methylphenyl (E)-2-ethyl-2-butenoate
Molecular structure of 4-methylphenyl (E)-2-ethyl-2-butenoate
2-methylpropyl (E)-3-phenylprop-2-enoate
Molecular structure of 2-methylpropyl (E)-3-phenylprop-2-enoate
1,2,3,4,5,6,7,8-octahydro-9H-xanthen-9-one
Molecular structure of 1,2,3,4,5,6,7,8-octahydro-9H-xanthen-9-one
vinyl 4-tert-butylbenzoate
Molecular structure of vinyl 4-tert-butylbenzoate