4'-aminobenzanilide


4'-aminobenzanilide
Links:📏 NIST, 🕷 ChemSpider
CAS:[17625-83-1]
Formula:C13H12N2O; 212.25 g/mol
InChiKey:GTTFJYUWPUKXJH-UHFFFAOYSA-N
SMILES:Nc1ccc(NC(=O)c2ccccc2)cc1
Molecular structure of 4'-aminobenzanilide
Melting point:129 °C

Isomers

2-aminobenzanilide
Molecular structure of 2-aminobenzanilide
4-aminobenzanilide
Molecular structure of 4-aminobenzanilide
4'-aminobenzanilide
Molecular structure of 4'-aminobenzanilide
2-[(2-aminophenyl)methylideneamino]phenol
Molecular structure of 2-[(2-aminophenyl)methylideneamino]phenol
1-biphenyl-4-ylurea
Molecular structure of 1-biphenyl-4-ylurea
bis(3-aminophenyl)methanone
Molecular structure of bis(3-aminophenyl)methanone
bis(4-aminophenyl)methanone
Molecular structure of bis(4-aminophenyl)methanone
3,4-diaminobenzophenone
Molecular structure of 3,4-diaminobenzophenone
3-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-ol
Molecular structure of 3-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-ol
N,N'-diphenylurea
Molecular structure of N,N'-diphenylurea
1,1-di(phenyl)urea
Molecular structure of 1,1-di(phenyl)urea
harmine
Molecular structure of harmine
2-hydroxybenzaldehyde phenylhydrazone
Molecular structure of 2-hydroxybenzaldehyde phenylhydrazone
(2-methoxyphenyl)phenyldiazene
Molecular structure of (2-methoxyphenyl)phenyldiazene
(4-methoxyphenyl)-phenyldiazene
Molecular structure of (4-methoxyphenyl)-phenyldiazene
3-methyl-4-(phenylazo)phenol
Molecular structure of 3-methyl-4-(phenylazo)phenol
4-methyl-2-(phenylazo)phenol
Molecular structure of 4-methyl-2-(phenylazo)phenol
N'-phenylbenzohydrazide
Molecular structure of N'-phenylbenzohydrazide
4-phenylbenzohydrazide
Molecular structure of 4-phenylbenzohydrazide