3-nitro-N-methylaniline


m-nitromethylaniline; 3-nitro-N-methylaniline
CAS:[619-26-1]
Formula:C7H8N2O2; 152.15 g/mol
InChiKey:IKSRCCUOUJJGAU-UHFFFAOYSA-N
SMILES:CNc1cccc(c1)[N+]([O-])=O
Molecular structure of 3-nitro-N-methylaniline
Melting point:68 °C

Isomers

allyl 1H-imidazole-1-carboxylate
Molecular structure of allyl 1H-imidazole-1-carboxylate
4-amino-2-hydroxybenzamide
Molecular structure of 4-amino-2-hydroxybenzamide
2,4-diaminobenzoic acid
Molecular structure of 2,4-diaminobenzoic acid
3,4-diaminobenzoic acid
Molecular structure of 3,4-diaminobenzoic acid
3,5-diaminobenzoic acid
Molecular structure of 3,5-diaminobenzoic acid
2,6-dimethyl-3-nitropyridine
Molecular structure of 2,6-dimethyl-3-nitropyridine
ethyl pyridazine-3-carboxylate
Molecular structure of ethyl pyridazine-3-carboxylate
4-hydrazinobenzoic acid
Molecular structure of 4-hydrazinobenzoic acid
3-hydroxybenzhydrazide
Molecular structure of 3-hydroxybenzhydrazide
2-hydroxybenzohydrazide
Molecular structure of 2-hydroxybenzohydrazide
4-hydroxybenzohydrazide
Molecular structure of 4-hydroxybenzohydrazide
N-(hydroxymethyl)pyridine-3-carboxamide
Molecular structure of N-(hydroxymethyl)pyridine-3-carboxamide
methyl 2-aminopyridine-3-carboxylate
Molecular structure of methyl 2-aminopyridine-3-carboxylate
methyl 2-aminopyridine-4-carboxylate
Molecular structure of methyl 2-aminopyridine-4-carboxylate
methyl 6-aminopyridine-3-carboxylate
Molecular structure of methyl 6-aminopyridine-3-carboxylate
2-(methylamino)pyridine-3-carboxylic acid
Molecular structure of 2-(methylamino)pyridine-3-carboxylic acid
N-methyl-2-nitroaniline
Molecular structure of N-methyl-2-nitroaniline
2-methyl-3-nitroaniline
Molecular structure of 2-methyl-3-nitroaniline
2-methyl-4-nitroaniline
Molecular structure of 2-methyl-4-nitroaniline
2-methyl-5-nitroaniline
Molecular structure of 2-methyl-5-nitroaniline
2-methyl-6-nitroaniline
Molecular structure of 2-methyl-6-nitroaniline
N-methyl-3-nitroaniline
Molecular structure of N-methyl-3-nitroaniline
3-methyl-4-nitroaniline
Molecular structure of 3-methyl-4-nitroaniline
N-methyl-4-nitroaniline
Molecular structure of N-methyl-4-nitroaniline
4-methyl-2-nitroaniline
Molecular structure of 4-methyl-2-nitroaniline
4-methyl-3-nitroaniline
Molecular structure of 4-methyl-3-nitroaniline
5-methyl-2-nitroaniline
Molecular structure of 5-methyl-2-nitroaniline
N-methyl-N-phenylnitramide
Molecular structure of N-methyl-N-phenylnitramide
3-nitro-4-aminotoluene
Molecular structure of 3-nitro-4-aminotoluene
4-nitro-2-aminotoluene
Molecular structure of 4-nitro-2-aminotoluene
5-nitro-2-aminotoluene
Molecular structure of 5-nitro-2-aminotoluene
3-nitrobenzylamine
Molecular structure of 3-nitrobenzylamine
2-nitro-N-methylaniline
Molecular structure of 2-nitro-N-methylaniline
3-nitro-N-methylaniline
Molecular structure of 3-nitro-N-methylaniline
4-nitro-N-methylaniline
Molecular structure of 4-nitro-N-methylaniline