3-methyl-2-benzoxazolinone


N-methyl-2-benzoxazolinone; 3-methyl-2-benzoxazolinone; 3-methyl-2(3H)-benzoxazolone
CAS:[21892-80-8]
Formula:C8H7NO2; 149.15 g/mol
InChiKey:QRMRRLXXFHXMBC-UHFFFAOYSA-N
SMILES:CN1C(=O)Oc2ccccc12
Molecular structure of 3-methyl-2-benzoxazolinone
Dipole moment:4.18 D
Melting point:87 °C

Isomers

6-amino-3H-2-benzofuran-1-one
Molecular structure of 6-amino-3H-2-benzofuran-1-one
2H-1,4-benzoxazin-3(4~H)-one
Molecular structure of 2H-1,4-benzoxazin-3(4H)-one
5,6-dihydroxyindole
Molecular structure of 5,6-dihydroxyindole
ethenyl pyridine-3-carboxylate
Molecular structure of ethenyl pyridine-3-carboxylate
ethenyl pyridine-4-carboxylate
Molecular structure of ethenyl pyridine-4-carboxylate
4-formylbenzamide
Molecular structure of 4-formylbenzamide
(2E)-2-hydroxyimino-1-phenylethanone
Molecular structure of (2E)-2-hydroxyimino-1-phenylethanone
4-hydroxy-3-methoxybenzonitrile
Molecular structure of 4-hydroxy-3-methoxybenzonitrile
2-methoxyphenyl isocyanate
Molecular structure of 2-methoxyphenyl isocyanate
3-methoxyphenyl isocyanate
Molecular structure of 3-methoxyphenyl isocyanate
4-methoxyphenyl isocyanate
Molecular structure of 4-methoxyphenyl isocyanate
3-methyl-2-benzoxazolinone
Molecular structure of 3-methyl-2-benzoxazolinone
6-methyl-2-benzoxazolinone
Molecular structure of 6-methyl-2-benzoxazolinone
1-nitro-2-vinylbenzene
Molecular structure of 1-nitro-2-vinylbenzene
1-nitro-3-vinylbenzene
Molecular structure of 1-nitro-3-vinylbenzene
1-nitro-4-vinylbenzene
Molecular structure of 1-nitro-4-vinylbenzene
(E)-2-nitrovinylbenzene
Molecular structure of (E)-2-nitrovinylbenzene
N-(4-oxo-1-cyclohexa-2,5-dienylidene)acetamide
Molecular structure of N-(4-oxo-1-cyclohexa-2,5-dienylidene)acetamide
2-oxo-2-phenylacetamide
Molecular structure of 2-oxo-2-phenylacetamide
(E)-3-pyridin-3-ylprop-2-enoic acid
Molecular structure of (E)-3-pyridin-3-ylprop-2-enoic acid
3-(2-pyridyl)-2-propenoic acid
Molecular structure of 3-(2-pyridyl)-2-propenoic acid
3-(4-pyridyl)-2-propenoic acid
Molecular structure of 3-(4-pyridyl)-2-propenoic acid
vinyl picolinate
Molecular structure of vinyl picolinate