2-nitro-1,3-dimethylbenzene


2-nitro-1,3-dimethylbenzene; 2-nitro-m-xylene
CAS:[81-20-9]
Formula:C8H9NO2; 151.16 g/mol
InChiKey:HDFQKJQEWGVKCQ-UHFFFAOYSA-N
SMILES:Cc1cccc(C)c1[N+]([O-])=O
Molecular structure of 2-nitro-1,3-dimethylbenzene
Density:1.110 g/mL
Molar volume:136.2 mL/mol
Refractive index:1.522
Molecular refractive power:41.53 mL/mol
Melting point:15 °C
Boiling point:226 °C
Log10 partition octanol / water:2.95

Isomers

2-acetamidophenol
Molecular structure of 2-acetamidophenol
3-acetamidophenol
Molecular structure of 3-acetamidophenol
N-acetyl-4-aminophenol
Molecular structure of N-acetyl-4-aminophenol
5-acetyl-2-methoxypyridine
Molecular structure of 5-acetyl-2-methoxypyridine
2-amino-3-methylbenzoic acid
Molecular structure of 2-amino-3-methylbenzoic acid
2-amino-5-methylbenzoic acid
Molecular structure of 2-amino-5-methylbenzoic acid
2-amino-6-methylbenzoic acid
Molecular structure of 2-amino-6-methylbenzoic acid
3-amino-2-methylbenzoic acid
Molecular structure of 3-amino-2-methylbenzoic acid
3-amino-4-methylbenzoic acid
Molecular structure of 3-amino-4-methylbenzoic acid
4-(aminomethyl)benzoic acid
Molecular structure of 4-(aminomethyl)benzoic acid
4-amino-2-methylbenzoic acid
Molecular structure of 4-amino-2-methylbenzoic acid
4-amino-3-methylbenzoic acid
Molecular structure of 4-amino-3-methylbenzoic acid
5-amino-2-methylbenzoic acid
Molecular structure of 5-amino-2-methylbenzoic acid
4-aminophenyl acetate
Molecular structure of 4-aminophenyl acetate
(2R)-2-amino-2-phenylacetic acid
Molecular structure of (2R)-2-amino-2-phenylacetic acid
(2S)-2-amino-2-phenylacetic acid
Molecular structure of (2S)-2-amino-2-phenylacetic acid
2-amino-2-phenylacetic acid
Molecular structure of 2-amino-2-phenylacetic acid
4-aminophenylacetic acid
Molecular structure of 4-aminophenylacetic acid
anisaldoxime
Molecular structure of anisaldoxime
1,4-benzodioxan-6-amine
Molecular structure of 1,4-benzodioxan-6-amine
benzyl carbamate
Molecular structure of benzyl carbamate
1,2-dimethyl-3-nitrobenzene
Molecular structure of 1,2-dimethyl-3-nitrobenzene
1,2-dimethyl-4-nitrobenzene
Molecular structure of 1,2-dimethyl-4-nitrobenzene
1,3-dimethyl-2-nitrobenzene
Molecular structure of 1,3-dimethyl-2-nitrobenzene
1,3-dimethyl-5-nitrobenzene
Molecular structure of 1,3-dimethyl-5-nitrobenzene
1,4-dimethyl-2-nitrobenzene
Molecular structure of 1,4-dimethyl-2-nitrobenzene
2,4-dimethyl-1-nitrobenzene
Molecular structure of 2,4-dimethyl-1-nitrobenzene
4,6-dimethylpyridine-2-carboxylic acid
Molecular structure of 4,6-dimethylpyridine-2-carboxylic acid
1-ethyl-2-nitrobenzene
Molecular structure of 1-ethyl-2-nitrobenzene
1-ethyl-3-nitrobenzene
Molecular structure of 1-ethyl-3-nitrobenzene
1-ethyl-4-nitrobenzene
Molecular structure of 1-ethyl-4-nitrobenzene
ethyl pyridine-2-carboxylate
Molecular structure of ethyl pyridine-2-carboxylate
ethyl 3-pyridinecarboxylate
Molecular structure of ethyl 3-pyridinecarboxylate
ethyl pyridine-4-carboxylate
Molecular structure of ethyl pyridine-4-carboxylate
2,3,4,5,6,7-hexahydro-1H-isoindole-1,3-dione
Molecular structure of 2,3,4,5,6,7-hexahydro-1H-isoindole-1,3-dione
4-hydroxyacetanilide
Molecular structure of 4-hydroxyacetanilide
4'-hydroxyacetophenone oxime
Molecular structure of 4'-hydroxyacetophenone oxime
N-(hydroxymethyl)benzamide
Molecular structure of N-(hydroxymethyl)benzamide
2-(hydroxymethyl)benzamide
Molecular structure of 2-(hydroxymethyl)benzamide
2-hydroxy-N-methylbenzamide
Molecular structure of 2-hydroxy-N-methylbenzamide
2-hydroxy-4-methylbenzamide
Molecular structure of 2-hydroxy-4-methylbenzamide
4-(hydroxymethyl)benzamide
Molecular structure of 4-(hydroxymethyl)benzamide
N-(2-hydroxyphenyl)acetamide
Molecular structure of N-(2-hydroxyphenyl)acetamide
2-hydroxy-2-phenylacetamide
Molecular structure of 2-hydroxy-2-phenylacetamide
N-(3-hydroxyphenyl)acetamide
Molecular structure of N-(3-hydroxyphenyl)acetamide
4-hydroxyphenylacetamide
Molecular structure of 4-hydroxyphenylacetamide
p-methoxy-anti-benzaldoxime
Molecular structure of p-methoxy-anti-benzaldoxime
(Z)-4-methoxybenzaldehyde oxime
Molecular structure of (Z)-4-methoxybenzaldehyde oxime
(E)-2-methoxybenzaldoxime
Molecular structure of (E)-2-methoxybenzaldoxime
(E)-3-methoxybenzaldoxime
Molecular structure of (E)-3-methoxybenzaldoxime
(E)-4-methoxybenzaldoxime
Molecular structure of (E)-4-methoxybenzaldoxime
2-methoxybenzamide
Molecular structure of 2-methoxybenzamide
3-methoxybenzamide
Molecular structure of 3-methoxybenzamide
4-methoxybenzamide
Molecular structure of 4-methoxybenzamide
N-(3-methoxyphenyl)formamide
Molecular structure of N-(3-methoxyphenyl)formamide
N-(4-methoxyphenyl)formamide
Molecular structure of N-(4-methoxyphenyl)formamide
p-methoxy-syn-benzaldoxime
Molecular structure of p-methoxy-syn-benzaldoxime
methyl 2-aminobenzoate
Molecular structure of methyl 2-aminobenzoate
methyl 3-aminobenzoate
Molecular structure of methyl 3-aminobenzoate
methyl 4-aminobenzoate
Molecular structure of methyl 4-aminobenzoate
2-methylaminobenzoic acid
Molecular structure of 2-methylaminobenzoic acid
3-(methylamino)benzoic acid
Molecular structure of 3-(methylamino)benzoic acid
4-(methylamino)benzoic acid
Molecular structure of 4-(methylamino)benzoic acid
3,4-(methylenedioxy)benzylamine
Molecular structure of 3,4-(methylenedioxy)benzylamine
methyl 2-methylpyridine-3-carboxylate
Molecular structure of methyl 2-methylpyridine-3-carboxylate
methyl 3-methylpyridine-2-carboxylate
Molecular structure of methyl 3-methylpyridine-2-carboxylate
methyl 4-methylpyridine-2-carboxylate
Molecular structure of methyl 4-methylpyridine-2-carboxylate
methyl 6-methylpyridine-3-carboxylate
Molecular structure of methyl 6-methylpyridine-3-carboxylate
1-methyl-4-(nitromethyl)benzene
Molecular structure of 1-methyl-4-(nitromethyl)benzene
2-nitro-1,3-dimethylbenzene
Molecular structure of 2-nitro-1,3-dimethylbenzene
1-nitroethylbenzene
Molecular structure of 1-nitroethylbenzene
2-nitroethylbenzene
Molecular structure of 2-nitroethylbenzene
3-nitro-2-xylene
Molecular structure of 3-nitro-2-xylene
phenoxyacetamide
Molecular structure of phenoxyacetamide
2-(phenylamino)acetic acid
Molecular structure of 2-(phenylamino)acetic acid
phenyl N-methylcarbamate
Molecular structure of phenyl N-methylcarbamate
4-pyridinepropionic acid
Molecular structure of 4-pyridinepropionic acid
3-pyridin-2-ylpropanoic acid
Molecular structure of 3-pyridin-2-ylpropanoic acid
3-(3-pyridyl)propionic acid
Molecular structure of 3-(3-pyridyl)propionic acid
3α,4,7,7α-tetrahydro-1H-isoindole-1,3(2~H)-dione
Molecular structure of 3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione
cis-1,2,3,6-tetrahydrophthalimide
Molecular structure of cis-1,2,3,6-tetrahydrophthalimide