2-methylhexanedioic acid


2-methylhexanedioic acid
Links:🕷 ChemSpider
Formula:C7H12O4; 160.17 g/mol
InChiKey:JZUMVFMLJGSMRF-UHFFFAOYSA-N
SMILES:CC(CCCC(O)=O)C(O)=O
Molecular structure of 2-methylhexanedioic acid
Melting point:64 °C

Isomers

1-acetoxyethyl propanoate
Molecular structure of 1-acetoxyethyl propanoate
tert-butyl hydrogen malonate
Molecular structure of tert-butyl hydrogen malonate
2-butylpropanedioic acid
Molecular structure of 2-butylpropanedioic acid
1,2-diacetoxypropane
Molecular structure of 1,2-diacetoxypropane
1,3-diacetoxypropane
Molecular structure of 1,3-diacetoxypropane
diethylmalonic acid
Molecular structure of diethylmalonic acid
diethyl propanedioate
Molecular structure of diethyl propanedioate
dimethyl 2,2-dimethylpropanedioate
Molecular structure of dimethyl 2,2-dimethylpropanedioate
dimethyl ethylmalonate
Molecular structure of dimethyl ethylmalonate
dimethyl (2R)-2-methylbutanedioate
Molecular structure of dimethyl (2R)-2-methylbutanedioate
dimethyl 2-methylbutanedioate
Molecular structure of dimethyl 2-methylbutanedioate
dimethyl pentanedioate
Molecular structure of dimethyl pentanedioate
2,2-dimethylpentanedioic acid
Molecular structure of 2,2-dimethylpentanedioic acid
3,3-dimethylpentanedioic acid
Molecular structure of 3,3-dimethylpentanedioic acid
ethyl 2-acetoxypropanoate
Molecular structure of ethyl 2-acetoxypropanoate
ethyl hydrogen glutarate
Molecular structure of ethyl hydrogen glutarate
ethyl methyl butanedioate
Molecular structure of ethyl methyl butanedioate
3-ethylpentanedioic acid
Molecular structure of 3-ethylpentanedioic acid
ethyl 2-propanoyloxyacetate
Molecular structure of ethyl 2-propanoyloxyacetate
heptanedioic acid
Molecular structure of heptanedioic acid
2-methoxyethyl acetoacetate
Molecular structure of 2-methoxyethyl acetoacetate
(R)-(+)-3-methyladipic acid
Molecular structure of (R)-(+)-3-methyladipic acid
(-)-methyl (S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of (-)-methyl (S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
methyl (±)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of methyl (+-)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
methyl (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of methyl (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
(1-methylethyl)butanedioic acid
Molecular structure of (1-methylethyl)butanedioic acid
2-methylhexanedioic acid
Molecular structure of 2-methylhexanedioic acid
3-methylhexanedioic acid
Molecular structure of 3-methylhexanedioic acid
methyl hydrogen hexanedioate
Molecular structure of methyl hydrogen hexanedioate
methyl 5-methoxy-3-oxopentanoate
Molecular structure of methyl 5-methoxy-3-oxopentanoate
methylpropylpropanedioic acid
Molecular structure of methylpropylpropanedioic acid
2-(1-oxopropoxy)propanoic acid methyl ester
Molecular structure of 2-(1-oxopropoxy)propanoic acid methyl ester
2,4,8,10-tetraoxaspiro[5.5]undecane
Molecular structure of 2,4,8,10-tetraoxaspiro[5.5]undecane