2-acetylphenoxyacetic acid


2-acetylphenoxyacetic acid
Formula:C10H10O4; 194.19 g/mol
InChiKey:GQZDTCFUDGMSOS-UHFFFAOYSA-N
SMILES:CC(=O)c1ccccc1OCC(O)=O
Molecular structure of 2-acetylphenoxyacetic acid
Log10 partition octanol / water:1.25

Isomers

4-acetoxy-3-methoxybenzaldehyde
Molecular structure of 4-acetoxy-3-methoxybenzaldehyde
3-acetoxy-2-methylbenzoic acid
Molecular structure of 3-acetoxy-2-methylbenzoic acid
2-(5-acetyl-2-hydroxyphenyl)acetic acid
Molecular structure of 2-(5-acetyl-2-hydroxyphenyl)acetic acid
(2R)-2-acetyloxy-2-phenylacetic acid
Molecular structure of (2R)-2-acetyloxy-2-phenylacetic acid
(2S)-2-acetyloxy-2-phenylacetic acid
Molecular structure of (2S)-2-acetyloxy-2-phenylacetic acid
2-acetyloxy-2-phenylacetic acid
Molecular structure of 2-acetyloxy-2-phenylacetic acid
2-acetylphenoxyacetic acid
Molecular structure of 2-acetylphenoxyacetic acid
3-acetylphenoxyacetic acid
Molecular structure of 3-acetylphenoxyacetic acid
4-acetylphenoxyacetic acid
Molecular structure of 4-acetylphenoxyacetic acid
1,4-benzodioxane-6-acetic acid
Molecular structure of 1,4-benzodioxane-6-acetic acid
1,3-benzodioxol-5-ylmethyl acetate
Molecular structure of 1,3-benzodioxol-5-ylmethyl acetate
benzyl hydrogen malonate
Molecular structure of benzyl hydrogen malonate
benzylmalonic acid
Molecular structure of benzylmalonic acid
3-(2-carboxyphenyl)propionic acid
Molecular structure of 3-(2-carboxyphenyl)propionic acid
3-(4-carboxyphenyl)propionic acid
Molecular structure of 3-(4-carboxyphenyl)propionic acid
1,2-diacetoxybenzene
Molecular structure of 1,2-diacetoxybenzene
1,3-diacetoxybenzene
Molecular structure of 1,3-diacetoxybenzene
1,4-diacetoxybenzene
Molecular structure of 1,4-diacetoxybenzene
3,4-dihydro-2H-1,5-benzodioxepin-7-carboxylic acid
Molecular structure of 3,4-dihydro-2H-1,5-benzodioxepin-7-carboxylic acid
1,1'-(4,6-dihydroxy-1,3-phenylene)bisethanone
Molecular structure of 1,1'-(4,6-dihydroxy-1,3-phenylene)bisethanone
2,5-dimethoxybenzene-1,4-dicarboxaldehyde
Molecular structure of 2,5-dimethoxybenzene-1,4-dicarboxaldehyde
dimethyl isophthalate
Molecular structure of dimethyl isophthalate
dimethyl phthalate
Molecular structure of dimethyl phthalate
dimethyl terephthalate
Molecular structure of dimethyl terephthalate
3-ethoxycarbonylbenzoic acid
Molecular structure of 3-ethoxycarbonylbenzoic acid
ethyl 1,3-benzodioxole-5-carboxylate
Molecular structure of ethyl 1,3-benzodioxole-5-carboxylate
ethyl 2-carboxybenzoate
Molecular structure of ethyl 2-carboxybenzoate
ethyl 3-formyl-4-hydroxybenzoate
Molecular structure of ethyl 3-formyl-4-hydroxybenzoate
4-formyl-2-methoxyphenyl acetate
Molecular structure of 4-formyl-2-methoxyphenyl acetate
trans-3-hydroxy-4-methoxycinnamic acid
Molecular structure of trans-3-hydroxy-4-methoxycinnamic acid
trans-4-hydroxy-3-methoxycinnamic acid
Molecular structure of trans-4-hydroxy-3-methoxycinnamic acid
(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid
Molecular structure of (Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid
meconin
Molecular structure of meconin
3-(4-methoxyphenyl)-2-oxopropanoic acid
Molecular structure of 3-(4-methoxyphenyl)-2-oxopropanoic acid
methyl 4-acetoxybenzoate
Molecular structure of methyl 4-acetoxybenzoate
methyl 5-acetyl-2-hydroxybenzoate
Molecular structure of methyl 5-acetyl-2-hydroxybenzoate
methyl 2-acetyloxybenzoate
Molecular structure of methyl 2-acetyloxybenzoate
methyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate
Molecular structure of methyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate
3-(3,4-methylenedioxyphenyl)propionic acid
Molecular structure of 3-(3,4-methylenedioxyphenyl)propionic acid
1,2-phenylenediacetic acid
Molecular structure of 1,2-phenylenediacetic acid
1,3-phenylenediacetic acid
Molecular structure of 1,3-phenylenediacetic acid
1,4-phenylenediacetic acid
Molecular structure of 1,4-phenylenediacetic acid
(R)-(-)-phenylsuccinic acid
Molecular structure of (R)-(-)-phenylsuccinic acid
(S)-(+)-phenylsuccinic acid
Molecular structure of (S)-(+)-phenylsuccinic acid
phenylsuccinic acid
Molecular structure of phenylsuccinic acid
4,5,6,7-tetrahydro-4-oxobenzofuran-5-acetic acid
Molecular structure of 4,5,6,7-tetrahydro-4-oxobenzofuran-5-acetic acid