2-(benzoylamino)-2-hydroxyacetic acid


2-(benzoylamino)-2-hydroxyacetic acid; α-hydroxyhippuric acid
CAS:[16555-77-4]
Formula:C9H9NO4; 195.17 g/mol
InChiKey:GCWCVCCEIQXUQU-UHFFFAOYSA-N
SMILES:OC(NC(=O)c1ccccc1)C(O)=O
Molecular structure of 2-(benzoylamino)-2-hydroxyacetic acid
Melting point:211 °C
Log10 partition octanol / water:-0.27

Isomers

3-amino-4-(methoxycarbonyl)benzoic acid
Molecular structure of 3-amino-4-(methoxycarbonyl)benzoic acid
benzadox
Molecular structure of benzadox
2-(benzoylamino)-2-hydroxyacetic acid
Molecular structure of 2-(benzoylamino)-2-hydroxyacetic acid
2-(2-carbamoylphenoxy)acetic acid
Molecular structure of 2-(2-carbamoylphenoxy)acetic acid
4-carboxyphenylglycine
Molecular structure of 4-carboxyphenylglycine
3,5-dimethyl-4-nitrobenzoic acid
Molecular structure of 3,5-dimethyl-4-nitrobenzoic acid
dimethyl pyridine-2,5-dicarboxylate
Molecular structure of dimethyl pyridine-2,5-dicarboxylate
dimethyl pyridine-2,6-dicarboxylate
Molecular structure of dimethyl pyridine-2,6-dicarboxylate
dimethyl pyridine-3,5-dicarboxylate
Molecular structure of dimethyl pyridine-3,5-dicarboxylate
2,6-dimethyl-3,5-pyridinedicarboxylic acid
Molecular structure of 2,6-dimethyl-3,5-pyridinedicarboxylic acid
4-ethoxy-3-nitrobenzaldehyde
Molecular structure of 4-ethoxy-3-nitrobenzaldehyde
ethyl 2-nitrobenzoate
Molecular structure of ethyl 2-nitrobenzoate
ethyl 3-nitrobenzoate
Molecular structure of ethyl 3-nitrobenzoate
ethyl 4-nitrobenzoate
Molecular structure of ethyl 4-nitrobenzoate
5-ethylpyridine-2,3-dicarboxylic acid
Molecular structure of 5-ethylpyridine-2,3-dicarboxylic acid
N-(2-hydroxybenzoyl)glycine
Molecular structure of N-(2-hydroxybenzoyl)glycine
o-hydroxyhippuric acid
Molecular structure of o-hydroxyhippuric acid
2'-hydroxy-5'-methyl-3'-nitroacetophenone
Molecular structure of 2'-hydroxy-5'-methyl-3'-nitroacetophenone
2-methoxy-4-[(E)-2-nitroethenyl]phenol
Molecular structure of 2-methoxy-4-[(E)-2-nitroethenyl]phenol
1-(4-methoxy-3-nitrophenyl)ethanone
Molecular structure of 1-(4-methoxy-3-nitrophenyl)ethanone
methyl 2-methyl-3-nitrobenzoate
Molecular structure of methyl 2-methyl-3-nitrobenzoate
methyl 3-methyl-4-nitrobenzoate
Molecular structure of methyl 3-methyl-4-nitrobenzoate
methyl 4-methyl-3-nitrobenzoate
Molecular structure of methyl 4-methyl-3-nitrobenzoate
2-methyl-3-nitrophenylacetic acid
Molecular structure of 2-methyl-3-nitrophenylacetic acid
2-[(4-nitrophenoxy)methyl]oxirane
Molecular structure of 2-[(4-nitrophenoxy)methyl]oxirane
2-(4-nitrophenyl)-1,3-dioxolane
Molecular structure of 2-(4-nitrophenyl)-1,3-dioxolane
4-nitrophenyl propanoate
Molecular structure of 4-nitrophenyl propanoate
3-(2-nitrophenyl)propanoic acid
Molecular structure of 3-(2-nitrophenyl)propanoic acid
3-(4-nitrophenyl)propanoic acid
Molecular structure of 3-(4-nitrophenyl)propanoic acid
2-(4-nitrophenyl)propionic acid
Molecular structure of 2-(4-nitrophenyl)propionic acid