2,6-diphenylaniline


2,6-diphenylaniline
CAS:[87666-57-7]
Formula:C18H15N; 245.32 g/mol
InChiKey:DSQMLISBVUTWJB-UHFFFAOYSA-N
SMILES:Nc1c(cccc1c2ccccc2)c3ccccc3
Molecular structure of 2,6-diphenylaniline
Melting point:86 °C

Isomers

11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
Molecular structure of 11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
2,6-diphenylaniline
Molecular structure of 2,6-diphenylaniline
diphenyl-4-pyridylmethane
Molecular structure of diphenyl-4-pyridylmethane
triphenylamine
Molecular structure of triphenylamine