2,5-undecanedione


2,5-undecanedione
Links:🕷 ChemSpider, ⚗️ ChemSynthesis
CAS:[7018-92-0]
Formula:C11H20O2; 184.28 g/mol
InChiKey:ZHMCDZHVHDFSHO-UHFFFAOYSA-N
SMILES:CCCCCCC(=O)CCC(C)=O
Molecular structure of 2,5-undecanedione

Isomers

allyl octanoate
Molecular structure of allyl octanoate
citronellyl formate
Molecular structure of citronellyl formate
cyclohexanepentanoic acid
Molecular structure of cyclohexanepentanoic acid
cyclohexyl isovalerate
Molecular structure of cyclohexyl isovalerate
1,1-diethoxyhept-2-yne
Molecular structure of 1,1-diethoxyhept-2-yne
ethenyl 6,6-dimethylheptanoate
Molecular structure of ethenyl 6,6-dimethylheptanoate
ethyl cycloheptylacetate
Molecular structure of ethyl cycloheptylacetate
2-ethylhexyl prop-2-enoate
Molecular structure of 2-ethylhexyl prop-2-enoate
ethyl (E)-2-nonenoate
Molecular structure of ethyl (E)-2-nonenoate
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-heptyloxolan-2-one
Molecular structure of 5-heptyloxolan-2-one
5-hexyldihydro-5-methyl-2(3~H)-furanone
Molecular structure of 5-hexyldihydro-5-methyl-2(3H)-furanone
6-hexyloxan-2-one
Molecular structure of 6-hexyloxan-2-one
hexyl tiglate
Molecular structure of hexyl tiglate
isooctyl acrylate
Molecular structure of isooctyl acrylate
(1S,2R,5S)-2-isopropyl-5-methylcyclohexyl formate
Molecular structure of (1S,2R,5S)-2-isopropyl-5-methylcyclohexyl formate
l-menthyl formate
Molecular structure of l-menthyl formate
menthyl formate
Molecular structure of menthyl formate
octyl acrylate
Molecular structure of octyl acrylate
oxacyclododecan-2-one
Molecular structure of oxacyclododecan-2-one
2,2,7,7-tetramethyl-1,6-dioxaspiro[4,4]nonane
Molecular structure of 2,2,7,7-tetramethyl-1,6-dioxaspiro[4,4]nonane
2,2,6,6-tetramethyl-3,5-heptanedione
Molecular structure of 2,2,6,6-tetramethyl-3,5-heptanedione
2,2,7-trimethyloctane-3,5-dione
Molecular structure of 2,2,7-trimethyloctane-3,5-dione
2,5-undecanedione
Molecular structure of 2,5-undecanedione
undec-10-enoic acid
Molecular structure of undec-10-enoic acid
trans-2-undecenoic acid
Molecular structure of trans-2-undecenoic acid