2,5-dimethoxy-4-methylamphetamine


2,5-dimethoxy-4-methylamphetamine; 1-(2,5-dimethoxy-4-methylphenyl)propan-2-amine
Links:🌍 Wikipedia, 🕷 ChemSpider, 📖 PubMed
MeSH:Central Nervous System Agents; Hallucinogens; Neurotransmitter Agents; Psychotropic Drugs; Serotonin Receptor Agonists
CAS:[15588-95-1]
Formula:C12H19NO2; 209.29 g/mol
InChiKey:NTJQREUGJKIARY-UHFFFAOYSA-N
SMILES:COc1cc(CC(C)N)c(OC)cc1C
Molecular structure of 2,5-dimethoxy-4-methylamphetamine
Melting point:61 °C
Log10 partition octanol / water:2.24

Isomers

bamethan
Molecular structure of bamethan
tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
Molecular structure of tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
N-(2,2-diethoxyethyl)aniline
Molecular structure of N-(2,2-diethoxyethyl)aniline
2,5-dimethoxy-4-methylamphetamine
Molecular structure of 2,5-dimethoxy-4-methylamphetamine
ethyl 2-cyano-3,3-dipropylacrylate
Molecular structure of ethyl 2-cyano-3,3-dipropylacrylate
fepradinol
Molecular structure of fepradinol
2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
Molecular structure of 2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
Molecular structure of 3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
octyl 2-cyanoprop-2-enoate
Molecular structure of octyl 2-cyanoprop-2-enoate
2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide
Molecular structure of 2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide