2,3-butanediol dinitrate


2,3-butanediol dinitrate
Links:📏 NIST
CAS:[6423-45-6]
Formula:C4H8N2O6; 180.12 g/mol
InChiKey:NUUUZLCRVKJNBP-UHFFFAOYSA-N
SMILES:O=[N+]([O-])OC(C)C(O[N+](=O)[O-])C.
Molecular structure of 2,3-butanediol dinitrate
Density:1.306 g/mL
Molar volume:137.9 mL/mol
Refractive index:1.428
Molecular refractive power:35.45 mL/mol
Dielectric constant:28.80
Dipole moment:4.12 D
Viscosity:4.70 cP

Isomers

1,3-butanediol dinitrate
Molecular structure of 1,3-butanediol dinitrate
2,3-butanediol dinitrate
Molecular structure of 2,3-butanediol dinitrate
1-nitrooxybutan-2-yl nitrate
Molecular structure of 1-nitrooxybutan-2-yl nitrate
tetramethylene dinitrate
Molecular structure of tetramethylene dinitrate