1-(4-biphenylyl)ethanol


1-(4-biphenylyl)ethanol; 1-(4-biphenylyl)-1-ethanol; 1-(4-phenylphenyl)ethanol
CAS:[3562-73-0]
Formula:C14H14O; 198.26 g/mol
InChiKey:GOISDOCZKZYADO-UHFFFAOYSA-N
SMILES:CC(O)c1ccc(cc1)c2ccccc2
Molecular structure of 1-(4-biphenylyl)ethanol
Melting point:97 °C

Isomers

1-(4-biphenylyl)ethanol
Molecular structure of 1-(4-biphenylyl)ethanol
dibenzyl ether
Molecular structure of dibenzyl ether
1,3-dimethyl-2-phenoxybenzene
Molecular structure of 1,3-dimethyl-2-phenoxybenzene
1,1-diphenylethanol
Molecular structure of 1,1-diphenylethanol
1,2-diphenylethanol
Molecular structure of 1,2-diphenylethanol
2,2-diphenylethanol
Molecular structure of 2,2-diphenylethanol
1-ethoxy-3-phenylbenzene
Molecular structure of 1-ethoxy-3-phenylbenzene
1-ethyl-4-acetylnaphthalene
Molecular structure of 1-ethyl-4-acetylnaphthalene
2-methylbenzhydrol
Molecular structure of 2-methylbenzhydrol
4-methylbenzhydrol
Molecular structure of 4-methylbenzhydrol
1-methyl-2-(2-methylphenoxy)benzene
Molecular structure of 1-methyl-2-(2-methylphenoxy)benzene
1-methyl-3-(4-methylphenoxy)benzene
Molecular structure of 1-methyl-3-(4-methylphenoxy)benzene
1-methyl-4-(4-methylphenoxy)benzene
Molecular structure of 1-methyl-4-(4-methylphenoxy)benzene
2-methyl-1-naphthalen-2-ylpropan-1-one
Molecular structure of 2-methyl-1-naphthalen-2-ylpropan-1-one
5-methyl-2-phenylmethylphenol
Molecular structure of 5-methyl-2-phenylmethylphenol
(3-methylphenyl)-phenylmethanol
Molecular structure of (3-methylphenyl)-phenylmethanol
3-[(E)-2-phenylethenyl]cyclohex-2-en-1-one
Molecular structure of 3-[(E)-2-phenylethenyl]cyclohex-2-en-1-one
2-(2-phenylethyl)phenol
Molecular structure of 2-(2-phenylethyl)phenol
propyl 1-naphthyl ketone
Molecular structure of propyl 1-naphthyl ketone